|
Name |
(12S)-12-hydroxymonocerin
|
Molecular Formula | C16H20O7 | |
IUPAC Name* |
(2S,3aR,9bR)-6-hydroxy-2-[(2S)-2-hydroxypropyl]-7,8-dimethoxy-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one
|
|
SMILES |
C[C@@H](C[C@H]1C[C@@H]2[C@H](O1)C3=CC(=C(C(=C3C(=O)O2)O)OC)OC)O
|
|
InChI |
InChI=1S/C16H20O7/c1-7(17)4-8-5-11-14(22-8)9-6-10(20-2)15(21-3)13(18)12(9)16(19)23-11/h6-8,11,14,17-18H,4-5H2,1-3H3/t7-,8-,11+,14+/m0/s1
|
|
InChIKey |
OAWLQCWPKLOBPA-ZFIUTFFNSA-N
|
|
Synonyms |
(12S)-12-hydroxymonocerin; 12?beta?hydroxymonocerin; CHEMBL443677
|
|
CAS | NA | |
PubChem CID | 24896699 | |
ChEMBL ID | CHEMBL443677 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 324.32 | ALogp: | 1.7 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.819 |
Caco-2 Permeability: | -5.036 | MDCK Permeability: | 0.00003830 |
Pgp-inhibitor: | 0.023 | Pgp-substrate: | 0.061 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.817 | Plasma Protein Binding (PPB): | 62.22% |
Volume Distribution (VD): | 0.754 | Fu: | 19.52% |
CYP1A2-inhibitor: | 0.098 | CYP1A2-substrate: | 0.706 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.872 |
CYP2C9-inhibitor: | 0.053 | CYP2C9-substrate: | 0.742 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.33 |
CYP3A4-inhibitor: | 0.214 | CYP3A4-substrate: | 0.341 |
Clearance (CL): | 8.717 | Half-life (T1/2): | 0.621 |
hERG Blockers: | 0.038 | Human Hepatotoxicity (H-HT): | 0.7 |
Drug-inuced Liver Injury (DILI): | 0.598 | AMES Toxicity: | 0.266 |
Rat Oral Acute Toxicity: | 0.101 | Maximum Recommended Daily Dose: | 0.922 |
Skin Sensitization: | 0.301 | Carcinogencity: | 0.855 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.094 |
Respiratory Toxicity: | 0.832 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005388 | 1.000 | D0L1JW | 0.312 | ||||
ENC003801 | 0.771 | D04TDQ | 0.298 | ||||
ENC003612 | 0.771 | D09PJX | 0.296 | ||||
ENC002527 | 0.750 | D0D4HN | 0.276 | ||||
ENC003791 | 0.750 | D0F7CS | 0.272 | ||||
ENC003705 | 0.750 | D06GCK | 0.269 | ||||
ENC003205 | 0.613 | D02LZB | 0.255 | ||||
ENC005556 | 0.563 | D0G4KG | 0.247 | ||||
ENC005907 | 0.461 | D09DHY | 0.243 | ||||
ENC004992 | 0.423 | D0C1SF | 0.243 |