![]() |
Name |
(12R)-12-Hydroxymonocerin
|
Molecular Formula | C16H20O7 | |
IUPAC Name* |
(2S,3aR,9bR)-6-hydroxy-2-[(2R)-2-hydroxypropyl]-7,8-dimethoxy-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one
|
|
SMILES |
C[C@H](C[C@H]1C[C@@H]2[C@H](O1)C3=CC(=C(C(=C3C(=O)O2)O)OC)OC)O
|
|
InChI |
InChI=1S/C16H20O7/c1-7(17)4-8-5-11-14(22-8)9-6-10(20-2)15(21-3)13(18)12(9)16(19)23-11/h6-8,11,14,17-18H,4-5H2,1-3H3/t7-,8+,11-,14-/m1/s1
|
|
InChIKey |
OAWLQCWPKLOBPA-PCAXDNMNSA-N
|
|
Synonyms |
(12R)-12-Hydroxymonocerin; 12?alpha?hydroxymonocerin; CHEMBL488514
|
|
CAS | NA | |
PubChem CID | 24896700 | |
ChEMBL ID | CHEMBL488514 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 324.32 | ALogp: | 1.7 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.819 |
Caco-2 Permeability: | -5.205 | MDCK Permeability: | 0.00003650 |
Pgp-inhibitor: | 0.03 | Pgp-substrate: | 0.077 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.813 | Plasma Protein Binding (PPB): | 59.45% |
Volume Distribution (VD): | 0.92 | Fu: | 18.04% |
CYP1A2-inhibitor: | 0.109 | CYP1A2-substrate: | 0.726 |
CYP2C19-inhibitor: | 0.055 | CYP2C19-substrate: | 0.874 |
CYP2C9-inhibitor: | 0.11 | CYP2C9-substrate: | 0.788 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.343 |
CYP3A4-inhibitor: | 0.249 | CYP3A4-substrate: | 0.423 |
Clearance (CL): | 6.183 | Half-life (T1/2): | 0.531 |
hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.634 |
Drug-inuced Liver Injury (DILI): | 0.756 | AMES Toxicity: | 0.226 |
Rat Oral Acute Toxicity: | 0.127 | Maximum Recommended Daily Dose: | 0.931 |
Skin Sensitization: | 0.444 | Carcinogencity: | 0.685 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.085 |
Respiratory Toxicity: | 0.774 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005388 | ![]() |
1.000 | D0L1JW | ![]() |
0.312 | ||
ENC003801 | ![]() |
0.771 | D04TDQ | ![]() |
0.298 | ||
ENC003612 | ![]() |
0.771 | D09PJX | ![]() |
0.296 | ||
ENC002527 | ![]() |
0.750 | D0D4HN | ![]() |
0.276 | ||
ENC003791 | ![]() |
0.750 | D0F7CS | ![]() |
0.272 | ||
ENC003705 | ![]() |
0.750 | D06GCK | ![]() |
0.269 | ||
ENC003205 | ![]() |
0.613 | D02LZB | ![]() |
0.255 | ||
ENC005556 | ![]() |
0.563 | D0G4KG | ![]() |
0.247 | ||
ENC005907 | ![]() |
0.461 | D09DHY | ![]() |
0.243 | ||
ENC004992 | ![]() |
0.423 | D0C1SF | ![]() |
0.243 |