|
Name |
Monocerin
|
Molecular Formula | C16H20O6 | |
IUPAC Name* |
(2S,3aR,9bR)-6-hydroxy-7,8-dimethoxy-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one
|
|
SMILES |
CCC[C@H]1C[C@@H]2[C@H](O1)C3=CC(=C(C(=C3C(=O)O2)O)OC)OC
|
|
InChI |
InChI=1S/C16H20O6/c1-4-5-8-6-11-14(21-8)9-7-10(19-2)15(20-3)13(17)12(9)16(18)22-11/h7-8,11,14,17H,4-6H2,1-3H3/t8-,11+,14+/m0/s1
|
|
InChIKey |
VAYQNUBOZLPGDH-OLXJLDBKSA-N
|
|
Synonyms |
Monocerin; 30270-60-1; (2S,3aR,9bR)-6-hydroxy-7,8-dimethoxy-2-propyl-2,3,3a,9b-tetrahydrofuro[3,2-c]isochromen-5-one; CHEMBL488513; G7C424U3DJ; CHEBI:70148; (+)-MONOCERIN; MONOCERIN, (+)-; UNII-G7C424U3DJ; MEGxm0_000272; ACon0_000652; ACon1_001243; DTXSID70184361; HY-N6294; ZINC4098447; BDBM50335899; MFCD08274586; AKOS030213206; NCGC00169540-01; 5H-Furo(3,2-c)(2)benzopyran-5-one, 2,3,3a,9b-tetrahydro-6-hydroxy-7,8-dimethoxy-2-propyl-, (2S-(2alpha,3abeta,9bbeta))-; CS-0033374; C09953; Q2899189; BRD-K31616759-001-01-2; (2'E,4'S,7'R)-2',3'-DIDEHYDRO-7'-DEOXO-2'-DEOXY-4'-HYDROXY-7'-((1R)-1-HYDROXYETHYL)VERRUCARIN A; (2S,3AR,9BR)-2,3,3A,9B-TETRAHYDRO-6-HYDROXY-7,8-DIMETHOXY-2-PROPYL-5H-FURO(3,2-C)(2)BENZOPYRAN-5-ONE; 5H-FURO(3,2-C)(2)BENZOPYRAN-5-ONE, 2,3,3A,9B-TETRAHYDRO-6-HYDROXY-7,8-DIMETHOXY-2-PROPYL-, (2S,3AR,9BR)-; VERRUCARIN A, 2',3'-DIDEHYDRO-7'-DEOXO-2'-DEOXY-4'-HYDROXY-7'-((1R)-1-HYDROXYETHYL)-, (2'E,4'S,7'R)-
|
|
CAS | 30270-60-1 | |
PubChem CID | 92267 | |
ChEMBL ID | CHEMBL488513 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 308.33 | ALogp: | 2.9 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.86 |
Caco-2 Permeability: | -4.761 | MDCK Permeability: | 0.00002800 |
Pgp-inhibitor: | 0.116 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.506 | Plasma Protein Binding (PPB): | 91.11% |
Volume Distribution (VD): | 0.739 | Fu: | 5.84% |
CYP1A2-inhibitor: | 0.197 | CYP1A2-substrate: | 0.882 |
CYP2C19-inhibitor: | 0.242 | CYP2C19-substrate: | 0.878 |
CYP2C9-inhibitor: | 0.353 | CYP2C9-substrate: | 0.815 |
CYP2D6-inhibitor: | 0.044 | CYP2D6-substrate: | 0.492 |
CYP3A4-inhibitor: | 0.484 | CYP3A4-substrate: | 0.315 |
Clearance (CL): | 5.897 | Half-life (T1/2): | 0.395 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.539 |
Drug-inuced Liver Injury (DILI): | 0.656 | AMES Toxicity: | 0.362 |
Rat Oral Acute Toxicity: | 0.132 | Maximum Recommended Daily Dose: | 0.535 |
Skin Sensitization: | 0.747 | Carcinogencity: | 0.627 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.23 |
Respiratory Toxicity: | 0.752 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003801 | 1.000 | D0L1JW | 0.318 | ||||
ENC003612 | 1.000 | D04TDQ | 0.304 | ||||
ENC003205 | 0.776 | D0D4HN | 0.281 | ||||
ENC005388 | 0.771 | D0F7CS | 0.277 | ||||
ENC003791 | 0.722 | D09PJX | 0.263 | ||||
ENC002527 | 0.722 | D06GCK | 0.262 | ||||
ENC003705 | 0.722 | D02LZB | 0.259 | ||||
ENC005556 | 0.557 | D0G4KG | 0.253 | ||||
ENC004992 | 0.434 | D02DKD | 0.248 | ||||
ENC005163 | 0.425 | D09DHY | 0.248 |