![]() |
Name |
(2-Phenyl-1,3-dioxolan-4-yl)methyl 9-octadecenoate, cis-
|
Molecular Formula | C28H44O4 | |
IUPAC Name* |
(2-phenyl-1,3-dioxolan-4-yl)methyl (Z)-octadec-9-enoate
|
|
SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)OCC1COC(O1)C2=CC=CC=C2
|
|
InChI |
InChI=1S/C28H44O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-27(29)30-23-26-24-31-28(32-26)25-20-17-16-18-21-25/h9-10,16-18,20-21,26,28H,2-8,11-15,19,22-24H2,1H3/b10-9-
|
|
InChIKey |
CNQPKAWJKUVJLR-KTKRTIGZSA-N
|
|
Synonyms |
(2-Phenyl-1,3-dioxolan-4-yl)methyl 9-octadecenoate, cis-; 9-Octadecenoic acid, (2-phenyl-1,3-dioxolan-4-yl)methyl ester, cis-
|
|
CAS | NA | |
PubChem CID | 21160048 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 444.6 | ALogp: | 8.8 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 19 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 44.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 32 | QED Weighted: | 0.129 |
Caco-2 Permeability: | -4.89 | MDCK Permeability: | 0.00003150 |
Pgp-inhibitor: | 0.292 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.93 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.074 | Plasma Protein Binding (PPB): | 98.91% |
Volume Distribution (VD): | 2.038 | Fu: | 0.67% |
CYP1A2-inhibitor: | 0.091 | CYP1A2-substrate: | 0.206 |
CYP2C19-inhibitor: | 0.497 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.208 | CYP2C9-substrate: | 0.829 |
CYP2D6-inhibitor: | 0.46 | CYP2D6-substrate: | 0.132 |
CYP3A4-inhibitor: | 0.672 | CYP3A4-substrate: | 0.167 |
Clearance (CL): | 2.783 | Half-life (T1/2): | 0.374 |
hERG Blockers: | 0.437 | Human Hepatotoxicity (H-HT): | 0.074 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.456 |
Rat Oral Acute Toxicity: | 0.095 | Maximum Recommended Daily Dose: | 0.059 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.228 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.738 |
Respiratory Toxicity: | 0.392 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001648 | ![]() |
0.716 | D0OR6A | ![]() |
0.496 | ||
ENC001679 | ![]() |
0.586 | D0O1PH | ![]() |
0.495 | ||
ENC001670 | ![]() |
0.586 | D0O1TC | ![]() |
0.365 | ||
ENC001688 | ![]() |
0.556 | D07ILQ | ![]() |
0.363 | ||
ENC001680 | ![]() |
0.556 | D03NTJ | ![]() |
0.325 | ||
ENC001682 | ![]() |
0.556 | D05LQX | ![]() |
0.324 | ||
ENC000572 | ![]() |
0.556 | D0G2KD | ![]() |
0.322 | ||
ENC001540 | ![]() |
0.556 | D0Z5SM | ![]() |
0.321 | ||
ENC001657 | ![]() |
0.556 | D0P1RL | ![]() |
0.320 | ||
ENC001054 | ![]() |
0.554 | D0UE9X | ![]() |
0.313 |