![]() |
Name |
7-Octadecenoic acid, methyl ester
|
Molecular Formula | C19H36O2 | |
IUPAC Name* |
methyl (E)-octadec-7-enoate
|
|
SMILES |
CCCCCCCCCC/C=C/CCCCCC(=O)OC
|
|
InChI |
InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h12-13H,3-11,14-18H2,1-2H3/b13-12+
|
|
InChIKey |
XMONTNNUOWTMGE-OUKQBFOZSA-N
|
|
Synonyms |
7-Octadecenoic acid methyl ester; 57396-98-2; 7-Octadecenoic acid, methyl ester; Methyl 7-octadecenoate; SCHEMBL583989; (E)-7-Octadecenoic acid methyl ester; ZINC103682411; A902016
|
|
CAS | NA | |
PubChem CID | 5364440 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.5 | ALogp: | 7.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.204 |
Caco-2 Permeability: | -4.778 | MDCK Permeability: | 0.00002330 |
Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.921 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.429 | Plasma Protein Binding (PPB): | 99.22% |
Volume Distribution (VD): | 3.858 | Fu: | 1.02% |
CYP1A2-inhibitor: | 0.554 | CYP1A2-substrate: | 0.203 |
CYP2C19-inhibitor: | 0.453 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.273 | CYP2C9-substrate: | 0.966 |
CYP2D6-inhibitor: | 0.491 | CYP2D6-substrate: | 0.141 |
CYP3A4-inhibitor: | 0.55 | CYP3A4-substrate: | 0.06 |
Clearance (CL): | 3.469 | Half-life (T1/2): | 0.485 |
hERG Blockers: | 0.248 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.105 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.04 |
Skin Sensitization: | 0.962 | Carcinogencity: | 0.049 |
Eye Corrosion: | 0.923 | Eye Irritation: | 0.954 |
Respiratory Toxicity: | 0.838 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001688 | ![]() |
1.000 | D0O1PH | ![]() |
0.703 | ||
ENC001687 | ![]() |
0.935 | D0O1TC | ![]() |
0.519 | ||
ENC001627 | ![]() |
0.909 | D07ILQ | ![]() |
0.500 | ||
ENC001435 | ![]() |
0.900 | D0OR6A | ![]() |
0.469 | ||
ENC001714 | ![]() |
0.853 | D0Z5SM | ![]() |
0.462 | ||
ENC001645 | ![]() |
0.850 | D05ATI | ![]() |
0.446 | ||
ENC001670 | ![]() |
0.836 | D0UE9X | ![]() |
0.444 | ||
ENC001678 | ![]() |
0.833 | D00FGR | ![]() |
0.392 | ||
ENC001699 | ![]() |
0.800 | D0H2YX | ![]() |
0.388 | ||
ENC001555 | ![]() |
0.800 | D00MLW | ![]() |
0.385 |