![]() |
Name |
Glycidyl oleate
|
Molecular Formula | C21H38O3 | |
IUPAC Name* |
oxiran-2-ylmethyl (Z)-octadec-9-enoate
|
|
SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)OCC1CO1
|
|
InChI |
InChI=1S/C21H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(22)24-19-20-18-23-20/h9-10,20H,2-8,11-19H2,1H3/b10-9-
|
|
InChIKey |
VWYIWOYBERNXLX-KTKRTIGZSA-N
|
|
Synonyms |
Glycidyl oleate; 5431-33-4; Glycidol oleate; 2,3-Epoxypropyl oleate; Oleic acid glycidyl ester; Glycidyl octadecenoate; 2,3-Epoxy-1-propanol oleate; oxiran-2-ylmethyl (Z)-octadec-9-enoate; 2,3-Epoxypropyl ester of oleic acid; Oxiranylmethyl ester of 9-octadecenoic acid; Glycidyl Oleate-13C18; Oxiran-2-ylmethyl oleate; 9-OCTADECENOIC ACID (Z)-, OXIRANYLMETHYL ESTER; CHEMBL230967; CHEBI:82469; NSC-13542; G0I0157S14; NSC 13542; 1426395-63-2; 9-Octadecenoic acid (9Z)-, oxiranylmethyl ester; Oleic acid, 2,3-epoxypropyl ester; EINECS 226-588-0; Glycidylester kyseliny olejove [Czech]; Glycidylester kyseliny olejove; AI3-03518; Oxiranyl methyl ester 9-octadecenoic acid; starbld0005392; Oleic acid-glycidyl ester; (+/-)-oxiran-2-ylmethyl (9Z)-octadec-9-enoate; SCHEMBL471851; GLYCIDYL OLEATE [IARC]; Oleic acid,3-epoxypropyl ester; WLN: T3OTJ B1OV8U9; UNII-G0I0157S14; DTXSID101031637; NSC13542; BDBM50220353; C19426; Q27155965; Oleic acid-glycidyl ester 100 microg/mL in Acetonitrile; 9-OCTADECENOIC ACID (9Z)-, 2-OXIRANYLMETHYL ESTER
|
|
CAS | 5431-33-4 | |
PubChem CID | 5354568 | |
ChEMBL ID | CHEMBL230967 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.5 | ALogp: | 7.3 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 38.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 24 | QED Weighted: | 0.14 |
Caco-2 Permeability: | -4.859 | MDCK Permeability: | 0.00003130 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.971 |
30% Bioavailability (F30%): | 0.982 |
Blood-Brain-Barrier Penetration (BBB): | 0.145 | Plasma Protein Binding (PPB): | 98.11% |
Volume Distribution (VD): | 1.499 | Fu: | 1.15% |
CYP1A2-inhibitor: | 0.245 | CYP1A2-substrate: | 0.239 |
CYP2C19-inhibitor: | 0.326 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.159 | CYP2C9-substrate: | 0.752 |
CYP2D6-inhibitor: | 0.175 | CYP2D6-substrate: | 0.244 |
CYP3A4-inhibitor: | 0.633 | CYP3A4-substrate: | 0.103 |
Clearance (CL): | 4.256 | Half-life (T1/2): | 0.723 |
hERG Blockers: | 0.447 | Human Hepatotoxicity (H-HT): | 0.082 |
Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.796 |
Rat Oral Acute Toxicity: | 0.06 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.972 | Carcinogencity: | 0.346 |
Eye Corrosion: | 0.652 | Eye Irritation: | 0.946 |
Respiratory Toxicity: | 0.473 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001670 | ![]() |
0.784 | D0O1PH | ![]() |
0.646 | ||
ENC001679 | ![]() |
0.784 | D0O1TC | ![]() |
0.467 | ||
ENC001054 | ![]() |
0.760 | D07ILQ | ![]() |
0.466 | ||
ENC001680 | ![]() |
0.743 | D0OR6A | ![]() |
0.415 | ||
ENC001540 | ![]() |
0.743 | D0Z5SM | ![]() |
0.414 | ||
ENC001657 | ![]() |
0.743 | D0UE9X | ![]() |
0.400 | ||
ENC000572 | ![]() |
0.743 | D05ATI | ![]() |
0.398 | ||
ENC001682 | ![]() |
0.743 | D00MLW | ![]() |
0.378 | ||
ENC001688 | ![]() |
0.743 | D0H2YX | ![]() |
0.369 | ||
ENC001643 | ![]() |
0.725 | D00AOJ | ![]() |
0.360 |