NPs Basic Information
|
Name |
Methyl elaidate
|
| Molecular Formula | C19H36O2 | |
| IUPAC Name* |
methyl (E)-octadec-9-enoate
|
|
| SMILES |
CCCCCCCC/C=C/CCCCCCCC(=O)OC
|
|
| InChI |
InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3/b11-10+
|
|
| InChIKey |
QYDYPVFESGNLHU-ZHACJKMWSA-N
|
|
| Synonyms |
METHYL ELAIDATE; 1937-62-8; Elaidic acid methyl ester; methyl octadec-9-enoate; 2462-84-2; Methyl trans-9-octadecenoate; (E)-Methyl octadec-9-enoate; 9-Octadecenoic acid, methyl ester; methyl (E)-octadec-9-enoate; 9-Octadecenoic acid, methyl ester, (9E)-; Methyl 9-octadecenoate; Elaidic acid, methyl ester; trans-9-Octadecenoic Acid Methyl Ester; 9-Octadecenoic acid, methyl ester, (E)-; Methyl 9(E)-Octadecenoate; 625736WPN1; methyl-9-octadecenoate; Elaidic acid-methyl ester; Methyl (9E)-9-octadecenoate; Elaidic acid methyl; EINECS 217-712-4; MFCD00066521; methyloctadec-9-enoate; AI3-36449; 18:1n-9 methyl ester; 9-Octadecenoic acid methyl; ELAIDICACIDMETHYLESTER; SCHEMBL37372; SCHEMBL627648; methyl (9E)-octadec-9-enoate; DTXSID9062435; UNII-625736WPN1; DTXSID40883778; CHEBI:177481; trans-9-Octadecenoic methyl ester; BAA93762; CAA46284; ZINC8218511; Methyl elaidate, analytical standard; TRANS-OLEIC ACID METHYL ESTER; AKOS002676449; (E)-octadec-9-enoic acid methyl ester; Octadecenoic acid methyl ester, 9-(E)-; LS-14746; Methyl elaidate, >=99% (capillary GC); 9(E)-OCTADECENOIC ACID METHYL ESTER; CS-0368444; O0226; EN300-83039; D91837; EN300-7420463; A880241; J-012547; Q27891777; 1BC8F548-0D8F-42D0-8028-21FFDDF0626E; trans-9-Octadecenoic acid methyl ester, certified reference material, 10 mg/mL in heptane, ampule of 1 mL
|
|
| CAS | 1937-62-8 | |
| PubChem CID | 5280590 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 296.5 | ALogp: | 7.6 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 21 | QED Weighted: | 0.204 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.778 | MDCK Permeability: | 0.00002330 |
| Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.921 |
| 30% Bioavailability (F30%): | 0.996 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.429 | Plasma Protein Binding (PPB): | 99.22% |
| Volume Distribution (VD): | 3.858 | Fu: | 1.02% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.554 | CYP1A2-substrate: | 0.203 |
| CYP2C19-inhibitor: | 0.453 | CYP2C19-substrate: | 0.067 |
| CYP2C9-inhibitor: | 0.273 | CYP2C9-substrate: | 0.966 |
| CYP2D6-inhibitor: | 0.491 | CYP2D6-substrate: | 0.141 |
| CYP3A4-inhibitor: | 0.55 | CYP3A4-substrate: | 0.06 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 3.469 | Half-life (T1/2): | 0.485 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.248 | Human Hepatotoxicity (H-HT): | 0.039 |
| Drug-inuced Liver Injury (DILI): | 0.105 | AMES Toxicity: | 0.002 |
| Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.04 |
| Skin Sensitization: | 0.962 | Carcinogencity: | 0.049 |
| Eye Corrosion: | 0.923 | Eye Irritation: | 0.954 |
| Respiratory Toxicity: | 0.838 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001688 |  |
1.000 | D0O1PH |  |
0.703 | ||
| ENC001687 |  |
0.935 | D0O1TC |  |
0.519 | ||
| ENC001627 |  |
0.909 | D07ILQ |  |
0.500 | ||
| ENC001435 |  |
0.900 | D0OR6A |  |
0.469 | ||
| ENC001714 |  |
0.853 | D0Z5SM |  |
0.462 | ||
| ENC001645 |  |
0.850 | D05ATI |  |
0.446 | ||
| ENC001670 |  |
0.836 | D0UE9X |  |
0.444 | ||
| ENC001678 |  |
0.833 | D00FGR |  |
0.392 | ||
| ENC001699 |  |
0.800 | D0H2YX |  |
0.388 | ||
| ENC001555 |  |
0.800 | D00MLW |  |
0.385 | ||