|
Name |
Stigmasterol glucoside
|
Molecular Formula | C35H58O6 | |
IUPAC Name* |
(2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
|
|
SMILES |
CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C(C)C
|
|
InChI |
InChI=1S/C35H58O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h8-10,20-22,24-33,36-39H,7,11-19H2,1-6H3/b9-8+/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1
|
|
InChIKey |
VWDLOXMZIGUBKM-AUGXRQBFSA-N
|
|
Synonyms |
Stigmasterol glucoside; 19716-26-8; stigmasterol 3-O-beta-D-glucoside; CHEMBL447335; CHEBI:68383; stigmasterol 3-O-beta-D-glucopyranoside; Prosaponin; Stigmasterol 3-glucoside; stigmasteryl 3-beta-D-glucoside; DTXSID601289039; HY-N1200; BDBM50357395; ZINC49833002; 3-O-beta-D-glucopyranosylstigmasterol; AKOS037515192; Stigmasteryl-3-O-beta-D-glucopyranoside; (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol; stigma-5,22-dien-3-beta-D-glucopyranoside; CS-0016492; Stigmasta-5,22-dien-3-O-.beta.-D-glucopyranoside; Q27136880; (3beta,22E)-stigmasta-5,22-dien-3-yl beta-D-glucopyranoside; (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,1R,4S)-4-ethyl-1,5-dimethyl-hex-2-enyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol
|
|
CAS | 19716-26-8 | |
PubChem CID | 6602508 | |
ChEMBL ID | CHEMBL447335 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 574.8 | ALogp: | 7.0 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 99.4 | Aromatic Rings: | 5 |
Heavy Atoms: | 41 | QED Weighted: | 0.274 |
Caco-2 Permeability: | -4.857 | MDCK Permeability: | 0.00002580 |
Pgp-inhibitor: | 0.975 | Pgp-substrate: | 0.771 |
Human Intestinal Absorption (HIA): | 0.258 | 20% Bioavailability (F20%): | 0.933 |
30% Bioavailability (F30%): | 0.137 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 86.19% |
Volume Distribution (VD): | 1.183 | Fu: | 1.34% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.398 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.771 |
CYP2C9-inhibitor: | 0.11 | CYP2C9-substrate: | 0.038 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.151 |
CYP3A4-inhibitor: | 0.507 | CYP3A4-substrate: | 0.585 |
Clearance (CL): | 1.426 | Half-life (T1/2): | 0.113 |
hERG Blockers: | 0.469 | Human Hepatotoxicity (H-HT): | 0.189 |
Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.209 | Maximum Recommended Daily Dose: | 0.943 |
Skin Sensitization: | 0.783 | Carcinogencity: | 0.089 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.956 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001769 | 0.794 | D0Y7LD | 0.519 | ||||
ENC001545 | 0.675 | D07ORO | 0.410 | ||||
ENC003369 | 0.659 | D0B4RU | 0.394 | ||||
ENC001846 | 0.659 | D04RYU | 0.379 | ||||
ENC004803 | 0.652 | D0M4WA | 0.336 | ||||
ENC004758 | 0.582 | D0K0EK | 0.333 | ||||
ENC001558 | 0.582 | D0M2QH | 0.331 | ||||
ENC002290 | 0.540 | D0S0NK | 0.327 | ||||
ENC003458 | 0.531 | D0G8OC | 0.322 | ||||
ENC004550 | 0.520 | D0G3SH | 0.319 |