![]() |
Name |
(24S)-Ethylcholesta-3,5,22-triene
|
Molecular Formula | C29H46 | |
IUPAC Name* |
(8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene
|
|
SMILES |
CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CCC=C4)C)C)C(C)C
|
|
InChI |
InChI=1S/C29H46/c1-7-22(20(2)3)12-11-21(4)25-15-16-26-24-14-13-23-10-8-9-18-28(23,5)27(24)17-19-29(25,26)6/h8,10-13,20-22,24-27H,7,9,14-19H2,1-6H3/b12-11+/t21-,22-,24+,25-,26+,27+,28+,29-/m1/s1
|
|
InChIKey |
NGUVUCVJXSBIEN-LVSBIWLASA-N
|
|
Synonyms |
102491-96-3; (24S)-ETHYLCHOLESTA-3,5,22-TRIENE; (8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-Ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene; 3,5,22-Stigmastatriene; (22E)-Stigmasta-3,5,22-triene; ZINC59183670
|
|
CAS | NA | |
PubChem CID | 14345242 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 394.7 | ALogp: | 9.8 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.373 |
Caco-2 Permeability: | -4.72 | MDCK Permeability: | 0.00000859 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.985 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.054 | Plasma Protein Binding (PPB): | 89.69% |
Volume Distribution (VD): | 3.329 | Fu: | 1.05% |
CYP1A2-inhibitor: | 0.121 | CYP1A2-substrate: | 0.684 |
CYP2C19-inhibitor: | 0.25 | CYP2C19-substrate: | 0.95 |
CYP2C9-inhibitor: | 0.388 | CYP2C9-substrate: | 0.14 |
CYP2D6-inhibitor: | 0.666 | CYP2D6-substrate: | 0.778 |
CYP3A4-inhibitor: | 0.92 | CYP3A4-substrate: | 0.897 |
Clearance (CL): | 2.255 | Half-life (T1/2): | 0.045 |
hERG Blockers: | 0.955 | Human Hepatotoxicity (H-HT): | 0.347 |
Drug-inuced Liver Injury (DILI): | 0.128 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.192 | Maximum Recommended Daily Dose: | 0.916 |
Skin Sensitization: | 0.979 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.249 | Eye Irritation: | 0.206 |
Respiratory Toxicity: | 0.861 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001170 | ![]() |
0.723 | D0Y7LD | ![]() |
0.505 | ||
ENC001545 | ![]() |
0.708 | D0B4RU | ![]() |
0.368 | ||
ENC001846 | ![]() |
0.654 | D0G8OC | ![]() |
0.353 | ||
ENC003369 | ![]() |
0.654 | D06JPB | ![]() |
0.331 | ||
ENC003458 | ![]() |
0.640 | D0F1UL | ![]() |
0.330 | ||
ENC004758 | ![]() |
0.594 | D0G5CF | ![]() |
0.325 | ||
ENC001558 | ![]() |
0.594 | D06XMU | ![]() |
0.321 | ||
ENC001889 | ![]() |
0.540 | D0K0EK | ![]() |
0.321 | ||
ENC005238 | ![]() |
0.533 | D07BSQ | ![]() |
0.318 | ||
ENC001107 | ![]() |
0.505 | D0W5LS | ![]() |
0.304 |