![]() |
Name |
Brassicasterol
|
Molecular Formula | C28H46O | |
IUPAC Name* |
(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
|
|
SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C
|
|
InChI |
InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1
|
|
InChIKey |
OILXMJHPFNGGTO-ZAUYPBDWSA-N
|
|
Synonyms |
BRASSICASTEROL; 474-67-9; Brassicasterin; Ergosta-5,22(E)-dien-3beta-ol; Ergosta-5,22-dien-3-ol, (3b,22E)-; Ergosta-5,22E-dien-3beta-ol; 2B0KG2XFOF; (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol; 5,22-Cholestadien-24beta-methyl-3beta-ol; 24(R)-Methylcholesta-5,22E-dien-3beta-ol; UNII-2B0KG2XFOF; Ergosta-5,22-dien-3beta-ol; 24-Methylcholesta-5,22-dien-3beta-ol; EINECS 207-486-5; 5,22-Ergostadienol; 5,22-Ergostadien-3beta-ol; SCHEMBL165980; CHEBI:3168; BRASSICASTEROL [WHO-DD]; DTXSID80197124; Brassicasterol, from semisynthetic; ZINC4097813; LMST01030098; (22E)-ergosta-5,22-dien-3beta-ol; 24-methyl cholest-5,22-dien-3beta-ol; (3beta,22E)-ergosta-5,22-dien-3-ol; AS-78829; HY-113289; CS-0059521; Ergosta-5,22-dien-3-ol, (3beta,22E)-; C08813; E80559; (3.BETA.,22E)-ERGOSTA-5,22-DIEN-3-OL; 24-METHYL CHOLEST-5,22-DIEN-3.BETA.-OL; Q2700587; (22E,24R)-24-methylcholesta-5,22-dien-3beta-ol
|
|
CAS | 474-67-9 | |
PubChem CID | 5281327 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 398.7 | ALogp: | 8.0 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 20.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.485 |
Caco-2 Permeability: | -4.586 | MDCK Permeability: | 0.00001410 |
Pgp-inhibitor: | 0.958 | Pgp-substrate: | 0.702 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.934 |
30% Bioavailability (F30%): | 0.231 |
Blood-Brain-Barrier Penetration (BBB): | 0.174 | Plasma Protein Binding (PPB): | 89.41% |
Volume Distribution (VD): | 1.475 | Fu: | 1.57% |
CYP1A2-inhibitor: | 0.13 | CYP1A2-substrate: | 0.661 |
CYP2C19-inhibitor: | 0.187 | CYP2C19-substrate: | 0.938 |
CYP2C9-inhibitor: | 0.28 | CYP2C9-substrate: | 0.086 |
CYP2D6-inhibitor: | 0.134 | CYP2D6-substrate: | 0.363 |
CYP3A4-inhibitor: | 0.76 | CYP3A4-substrate: | 0.813 |
Clearance (CL): | 3.654 | Half-life (T1/2): | 0.045 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.187 |
Drug-inuced Liver Injury (DILI): | 0.225 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.514 | Maximum Recommended Daily Dose: | 0.92 |
Skin Sensitization: | 0.895 | Carcinogencity: | 0.041 |
Eye Corrosion: | 0.016 | Eye Irritation: | 0.17 |
Respiratory Toxicity: | 0.713 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004758 | ![]() |
1.000 | D0Y7LD | ![]() |
0.698 | ||
ENC001545 | ![]() |
0.852 | D0B4RU | ![]() |
0.600 | ||
ENC000961 | ![]() |
0.739 | D0K0EK | ![]() |
0.511 | ||
ENC001008 | ![]() |
0.698 | D0G8OC | ![]() |
0.509 | ||
ENC000125 | ![]() |
0.681 | D06JPB | ![]() |
0.468 | ||
ENC003369 | ![]() |
0.676 | D0G5CF | ![]() |
0.434 | ||
ENC005707 | ![]() |
0.649 | D02STN | ![]() |
0.409 | ||
ENC001092 | ![]() |
0.649 | D06XMU | ![]() |
0.404 | ||
ENC004738 | ![]() |
0.649 | D07BSQ | ![]() |
0.371 | ||
ENC004735 | ![]() |
0.616 | D04DJN | ![]() |
0.363 |