![]() |
Name |
Z-(13,14-Epoxy)tetradec-11-en-1-ol acetate
|
Molecular Formula | C16H28O3 | |
IUPAC Name* |
[(Z)-12-(oxiran-2-yl)dodec-11-enyl] acetate
|
|
SMILES |
CC(=O)OCCCCCCCCCC/C=C\C1CO1
|
|
InChI |
InChI=1S/C16H28O3/c1-15(17)18-13-11-9-7-5-3-2-4-6-8-10-12-16-14-19-16/h10,12,16H,2-9,11,13-14H2,1H3/b12-10-
|
|
InChIKey |
SSNSHVODQWMOJI-BENRWUELSA-N
|
|
Synonyms |
Z-(13,14-Epoxy)tetradec-11-en-1-ol acetate; DTXSID001016270; (11Z)-12-(2-Oxiranyl)-11-dodecenyl acetate #; (11Z)-12-(2-Oxiranyl)-11-dodecen-1-yl acetate; 863489-15-0
|
|
CAS | 863489-15-0 | |
PubChem CID | 5363633 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 268.39 | ALogp: | 4.5 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 19 | QED Weighted: | 0.224 |
Caco-2 Permeability: | -4.786 | MDCK Permeability: | 0.00003840 |
Pgp-inhibitor: | 0.127 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.998 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.916 | Plasma Protein Binding (PPB): | 87.57% |
Volume Distribution (VD): | 1.18 | Fu: | 10.10% |
CYP1A2-inhibitor: | 0.688 | CYP1A2-substrate: | 0.555 |
CYP2C19-inhibitor: | 0.618 | CYP2C19-substrate: | 0.16 |
CYP2C9-inhibitor: | 0.371 | CYP2C9-substrate: | 0.498 |
CYP2D6-inhibitor: | 0.066 | CYP2D6-substrate: | 0.187 |
CYP3A4-inhibitor: | 0.338 | CYP3A4-substrate: | 0.208 |
Clearance (CL): | 3.247 | Half-life (T1/2): | 0.716 |
hERG Blockers: | 0.167 | Human Hepatotoxicity (H-HT): | 0.09 |
Drug-inuced Liver Injury (DILI): | 0.349 | AMES Toxicity: | 0.637 |
Rat Oral Acute Toxicity: | 0.107 | Maximum Recommended Daily Dose: | 0.031 |
Skin Sensitization: | 0.955 | Carcinogencity: | 0.442 |
Eye Corrosion: | 0.401 | Eye Irritation: | 0.946 |
Respiratory Toxicity: | 0.381 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000494 | ![]() |
0.627 | D05ATI | ![]() |
0.403 | ||
ENC001152 | ![]() |
0.615 | D0O1PH | ![]() |
0.395 | ||
ENC001205 | ![]() |
0.576 | D0Z5SM | ![]() |
0.367 | ||
ENC000625 | ![]() |
0.576 | D0Z5BC | ![]() |
0.364 | ||
ENC001667 | ![]() |
0.529 | D07ILQ | ![]() |
0.326 | ||
ENC001671 | ![]() |
0.529 | D05QNO | ![]() |
0.325 | ||
ENC001648 | ![]() |
0.500 | D0Y8DP | ![]() |
0.319 | ||
ENC000424 | ![]() |
0.500 | D03JSJ | ![]() |
0.316 | ||
ENC001644 | ![]() |
0.492 | D0O1TC | ![]() |
0.315 | ||
ENC001257 | ![]() |
0.478 | D03ZJE | ![]() |
0.299 |