![]() |
Name |
E-8-Methyl-9-tetradecen-1-ol acetate
|
Molecular Formula | C17H32O2 | |
IUPAC Name* |
[(E)-8-methyltetradec-9-enyl] acetate
|
|
SMILES |
CCCC/C=C/C(C)CCCCCCCOC(=O)C
|
|
InChI |
InChI=1S/C17H32O2/c1-4-5-6-10-13-16(2)14-11-8-7-9-12-15-19-17(3)18/h10,13,16H,4-9,11-12,14-15H2,1-3H3/b13-10+
|
|
InChIKey |
XAIYESIBSJPKNQ-JLHYYAGUSA-N
|
|
Synonyms |
SCHEMBL20506172; DTXSID70873263; E-8-Methyl-9-tetradecen-1-ol acetate; (9E)-8-Methyl-9-tetradecenyl acetate #; (9E)-8-Methyl-9-tetradecen-1-yl acetate; 912629-93-7
|
|
CAS | 912629-93-7 | |
PubChem CID | 5363273 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 268.4 | ALogp: | 6.2 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 19 | QED Weighted: | 0.264 |
Caco-2 Permeability: | -4.661 | MDCK Permeability: | 0.00002870 |
Pgp-inhibitor: | 0.108 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.992 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.399 | Plasma Protein Binding (PPB): | 99.17% |
Volume Distribution (VD): | 2.66 | Fu: | 2.44% |
CYP1A2-inhibitor: | 0.861 | CYP1A2-substrate: | 0.319 |
CYP2C19-inhibitor: | 0.562 | CYP2C19-substrate: | 0.166 |
CYP2C9-inhibitor: | 0.402 | CYP2C9-substrate: | 0.846 |
CYP2D6-inhibitor: | 0.33 | CYP2D6-substrate: | 0.206 |
CYP3A4-inhibitor: | 0.637 | CYP3A4-substrate: | 0.15 |
Clearance (CL): | 2.932 | Half-life (T1/2): | 0.302 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.058 |
Drug-inuced Liver Injury (DILI): | 0.232 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.07 | Maximum Recommended Daily Dose: | 0.034 |
Skin Sensitization: | 0.932 | Carcinogencity: | 0.043 |
Eye Corrosion: | 0.562 | Eye Irritation: | 0.973 |
Respiratory Toxicity: | 0.249 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001667 | ![]() |
0.927 | D05ATI | ![]() |
0.370 | ||
ENC003059 | ![]() |
0.620 | D0G2KD | ![]() |
0.353 | ||
ENC000494 | ![]() |
0.610 | D0O1PH | ![]() |
0.352 | ||
ENC001669 | ![]() |
0.553 | D0O1TC | ![]() |
0.349 | ||
ENC001205 | ![]() |
0.533 | D0I4DQ | ![]() |
0.341 | ||
ENC000625 | ![]() |
0.533 | D0OR6A | ![]() |
0.340 | ||
ENC001675 | ![]() |
0.529 | D0AY9Q | ![]() |
0.338 | ||
ENC001673 | ![]() |
0.521 | D0Z5SM | ![]() |
0.338 | ||
ENC000742 | ![]() |
0.508 | D0H2YX | ![]() |
0.333 | ||
ENC000424 | ![]() |
0.486 | D0Z5BC | ![]() |
0.328 |