|
Name |
Hexadecyl acetate
|
Molecular Formula | C18H36O2 | |
IUPAC Name* |
hexadecyl acetate
|
|
SMILES |
CCCCCCCCCCCCCCCCOC(=O)C
|
|
InChI |
InChI=1S/C18H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h3-17H2,1-2H3
|
|
InChIKey |
LSTDYDRCKUBPDI-UHFFFAOYSA-N
|
|
Synonyms |
Hexadecyl acetate; Palmityl acetate; Cetyl acetate; 629-70-9; 1-Hexadecanol, acetate; 1-Acetoxyhexadecane; n-Hexadecyl ethanoate; Acetic acid, hexadecyl ester; ENT 1025; Hexadecanol acetate; 1-HEXADECANOL ACETATE; 1-Hexadecanol, 1-acetate; NSC 8492; n-hexadecyl acetate; 4Q43814HXS; NSC-8492; PALMITYLACETATE; EINECS 211-103-7; BRN 1782695; UNII-4Q43814HXS; AI3-01025; Acelan A; hexadecanyl acetate; Acetic acid hexadecyl; PELEMOL CA; Acetic acid hexadecyl ester; CETYL ACETATE [INCI]; 4-02-00-00171 (Beilstein Handbook Reference); SCHEMBL118101; CHEMBL137354; DTXSID2052312; NSC8492; CHEBI:146185; LMFA07010379; MFCD00056152; ZINC43381999; AKOS024390930; AS-10426; CS-0185766; E82294; Q27260353
|
|
CAS | 629-70-9 | |
PubChem CID | 12393 | |
ChEMBL ID | CHEMBL137354 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 284.5 | ALogp: | 7.7 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.269 |
Caco-2 Permeability: | -4.829 | MDCK Permeability: | 0.00001600 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.976 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.158 | Plasma Protein Binding (PPB): | 97.86% |
Volume Distribution (VD): | 1.941 | Fu: | 2.02% |
CYP1A2-inhibitor: | 0.422 | CYP1A2-substrate: | 0.185 |
CYP2C19-inhibitor: | 0.456 | CYP2C19-substrate: | 0.062 |
CYP2C9-inhibitor: | 0.143 | CYP2C9-substrate: | 0.883 |
CYP2D6-inhibitor: | 0.142 | CYP2D6-substrate: | 0.041 |
CYP3A4-inhibitor: | 0.248 | CYP3A4-substrate: | 0.062 |
Clearance (CL): | 3.276 | Half-life (T1/2): | 0.145 |
hERG Blockers: | 0.285 | Human Hepatotoxicity (H-HT): | 0.007 |
Drug-inuced Liver Injury (DILI): | 0.537 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.009 |
Skin Sensitization: | 0.956 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.98 | Eye Irritation: | 0.967 |
Respiratory Toxicity: | 0.758 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000496 | 0.754 | D07ILQ | 0.625 | ||||
ENC001161 | 0.754 | D0Z5SM | 0.609 | ||||
ENC000575 | 0.746 | D00FGR | 0.590 | ||||
ENC001234 | 0.746 | D00AOJ | 0.550 | ||||
ENC000427 | 0.738 | D05ATI | 0.529 | ||||
ENC000494 | 0.737 | D0O1PH | 0.464 | ||||
ENC000356 | 0.734 | D0T9TJ | 0.384 | ||||
ENC001243 | 0.732 | D00STJ | 0.379 | ||||
ENC001218 | 0.732 | D0P1RL | 0.376 | ||||
ENC000419 | 0.727 | D00MLW | 0.369 |