![]() |
Name |
Humulen-(v1)
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(3Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-3-ene
|
|
SMILES |
C/C/1=C/CC2C(CC2(C)C)C(=C)CCC1
|
|
InChI |
InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h8,13-14H,2,5-7,9-10H2,1,3-4H3/b11-8-
|
|
InChIKey |
NSMRKFBAPAOVQL-FLIBITNWSA-N
|
|
Synonyms |
Humulen-(v1); CHEBI:88638; (3Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-3-ene; Q27160524; 4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene #; 1R,3Z,9s-4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene; (1R),(3Z),(9S)-4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-3-ene
|
|
CAS | NA | |
PubChem CID | 5362885 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 4.4 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.478 |
Caco-2 Permeability: | -4.544 | MDCK Permeability: | 0.00001680 |
Pgp-inhibitor: | 0.031 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.877 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.935 | Plasma Protein Binding (PPB): | 93.18% |
Volume Distribution (VD): | 2.263 | Fu: | 3.98% |
CYP1A2-inhibitor: | 0.326 | CYP1A2-substrate: | 0.767 |
CYP2C19-inhibitor: | 0.347 | CYP2C19-substrate: | 0.871 |
CYP2C9-inhibitor: | 0.253 | CYP2C9-substrate: | 0.833 |
CYP2D6-inhibitor: | 0.064 | CYP2D6-substrate: | 0.905 |
CYP3A4-inhibitor: | 0.103 | CYP3A4-substrate: | 0.305 |
Clearance (CL): | 8.165 | Half-life (T1/2): | 0.166 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.17 |
Drug-inuced Liver Injury (DILI): | 0.087 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.359 |
Skin Sensitization: | 0.355 | Carcinogencity: | 0.079 |
Eye Corrosion: | 0.06 | Eye Irritation: | 0.89 |
Respiratory Toxicity: | 0.085 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001826 | ![]() |
0.673 | D0K0EK | ![]() |
0.235 | ||
ENC001630 | ![]() |
0.673 | D0L2LS | ![]() |
0.233 | ||
ENC001565 | ![]() |
0.673 | D06CGB | ![]() |
0.233 | ||
ENC001563 | ![]() |
0.673 | D0A2AJ | ![]() |
0.230 | ||
ENC002199 | ![]() |
0.519 | D0D2VS | ![]() |
0.229 | ||
ENC001739 | ![]() |
0.491 | D0Z1XD | ![]() |
0.229 | ||
ENC001469 | ![]() |
0.441 | D0F2AK | ![]() |
0.227 | ||
ENC001297 | ![]() |
0.397 | D04ATM | ![]() |
0.222 | ||
ENC000588 | ![]() |
0.390 | D07BSQ | ![]() |
0.221 | ||
ENC000574 | ![]() |
0.388 | D0G8BV | ![]() |
0.221 |