|
Name |
5-hydroxyramulosin
|
Molecular Formula | C10H14O4 | |
IUPAC Name* |
5,8-dihydroxy-3-methyl-3,4,4a,5,6,7-hexahydroisochromen-1-one
|
|
SMILES |
CC1CC2C(=C(O)CCC2O)C(=O)O1
|
|
InChI |
InChI=1S/C10H14O4/c1-5-4-6-7(11)2-3-8(12)9(6)10(13)14-5/h5-7,11-12H,2-4H2,1H3/t5-,6-,7-/m1/s1
|
|
InChIKey |
JWWNTVZAXCYTJC-FSDSQADBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 198.22 | ALogp: | 0.9 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.576 |
Caco-2 Permeability: | -4.528 | MDCK Permeability: | 0.00012866 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.791 | Plasma Protein Binding (PPB): | 20.65% |
Volume Distribution (VD): | 1.161 | Fu: | 80.66% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.135 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.395 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.513 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.408 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.266 |
Clearance (CL): | 10.832 | Half-life (T1/2): | 0.809 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.288 |
Drug-inuced Liver Injury (DILI): | 0.407 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.388 | Maximum Recommended Daily Dose: | 0.336 |
Skin Sensitization: | 0.045 | Carcinogencity: | 0.147 |
Eye Corrosion: | 0.021 | Eye Irritation: | 0.178 |
Respiratory Toxicity: | 0.029 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004882 | 0.625 | D0Z1FX | 0.244 | ||||
ENC003402 | 0.520 | D04CSZ | 0.241 | ||||
ENC004916 | 0.444 | D0A2AJ | 0.239 | ||||
ENC002040 | 0.370 | D0CL9S | 0.235 | ||||
ENC002701 | 0.352 | D04JHN | 0.225 | ||||
ENC004214 | 0.338 | D0G6AB | 0.220 | ||||
ENC005006 | 0.338 | D0R2KF | 0.219 | ||||
ENC005373 | 0.321 | D04VIS | 0.218 | ||||
ENC002592 | 0.317 | D08QMX | 0.218 | ||||
ENC003158 | 0.315 | D00ZFP | 0.218 |