|
Name |
(3R, 4aR, 5S, 6R)-6-hydroxy-5methylramulosin
|
Molecular Formula | C11H16O4 | |
IUPAC Name* |
6,8-dihydroxy-3,5-dimethyl-3,4,4a,5,6,7-hexahydroisochromen-1-one
|
|
SMILES |
CC1CC2C(=C(O)CC(O)C2C)C(=O)O1
|
|
InChI |
InChI=1S/C11H16O4/c1-5-3-7-6(2)8(12)4-9(13)10(7)11(14)15-5/h5-8,12-13H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1
|
|
InChIKey |
GEGLAKDBJQTGDZ-ULAWRXDQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 212.24 | ALogp: | 1.2 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.599 |
Caco-2 Permeability: | -4.585 | MDCK Permeability: | 0.00010967 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.019 |
Blood-Brain-Barrier Penetration (BBB): | 0.911 | Plasma Protein Binding (PPB): | 16.47% |
Volume Distribution (VD): | 1.074 | Fu: | 77.32% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.13 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.774 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.333 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.25 |
CYP3A4-inhibitor: | 0.025 | CYP3A4-substrate: | 0.317 |
Clearance (CL): | 13.56 | Half-life (T1/2): | 0.543 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.297 |
Drug-inuced Liver Injury (DILI): | 0.544 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.34 | Maximum Recommended Daily Dose: | 0.037 |
Skin Sensitization: | 0.049 | Carcinogencity: | 0.131 |
Eye Corrosion: | 0.021 | Eye Irritation: | 0.168 |
Respiratory Toxicity: | 0.034 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004916 | 0.739 | D0R2KF | 0.230 | ||||
ENC005043 | 0.625 | D0CL9S | 0.229 | ||||
ENC003402 | 0.500 | D0A2AJ | 0.216 | ||||
ENC004876 | 0.356 | D03KXY | 0.214 | ||||
ENC004875 | 0.356 | D0TS1Z | 0.211 | ||||
ENC004873 | 0.356 | D09PZO | 0.211 | ||||
ENC004874 | 0.356 | D04CSZ | 0.211 | ||||
ENC005663 | 0.333 | D0Z1FX | 0.207 | ||||
ENC002040 | 0.333 | D0WE3O | 0.205 | ||||
ENC004214 | 0.328 | D07AHW | 0.203 |