|
Name |
Aniquinazoline D
|
Molecular Formula | C24H22N4O4 | |
IUPAC Name* |
(1S,10S,13R,15S)-1-hydroxy-13-(4-oxoquinazolin-3-yl)-10-propan-2-yl-8,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6-triene-9,12-dione
|
|
SMILES |
CC(C)[C@H]1C(=O)N2[C@@H]3N1C(=O)[C@@H](C[C@@]3(C4=CC=CC=C42)O)N5C=NC6=CC=CC=C6C5=O
|
|
InChI |
InChI=1S/C24H22N4O4/c1-13(2)19-22(31)27-17-10-6-4-8-15(17)24(32)11-18(21(30)28(19)23(24)27)26-12-25-16-9-5-3-7-14(16)20(26)29/h3-10,12-13,18-19,23,32H,11H2,1-2H3/t18-,19+,23-,24+/m1/s1
|
|
InChIKey |
NBKVRNRJWWLJKF-LZFFWASXSA-N
|
|
Synonyms |
Aniquinazoline D
|
|
CAS | NA | |
PubChem CID | 139585106 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 430.5 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.5 | Aromatic Rings: | 6 |
Heavy Atoms: | 32 | QED Weighted: | 0.674 |
Caco-2 Permeability: | -5.171 | MDCK Permeability: | 0.00005090 |
Pgp-inhibitor: | 0.233 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.7 |
Blood-Brain-Barrier Penetration (BBB): | 0.142 | Plasma Protein Binding (PPB): | 83.61% |
Volume Distribution (VD): | 0.994 | Fu: | 19.15% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.168 |
CYP2C19-inhibitor: | 0.214 | CYP2C19-substrate: | 0.811 |
CYP2C9-inhibitor: | 0.367 | CYP2C9-substrate: | 0.878 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.103 |
CYP3A4-inhibitor: | 0.684 | CYP3A4-substrate: | 0.936 |
Clearance (CL): | 5.938 | Half-life (T1/2): | 0.12 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.935 |
Drug-inuced Liver Injury (DILI): | 0.994 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.469 | Maximum Recommended Daily Dose: | 0.559 |
Skin Sensitization: | 0.853 | Carcinogencity: | 0.041 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.839 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002357 | 0.842 | D0QV5T | 0.293 | ||||
ENC002868 | 0.616 | D0B1FE | 0.292 | ||||
ENC000977 | 0.600 | D0DV3O | 0.292 | ||||
ENC001948 | 0.578 | D0E3OF | 0.292 | ||||
ENC004162 | 0.500 | D07VHR | 0.289 | ||||
ENC003203 | 0.492 | D08FTG | 0.287 | ||||
ENC002127 | 0.452 | D0QL3P | 0.286 | ||||
ENC002409 | 0.445 | D0J6WW | 0.284 | ||||
ENC003601 | 0.436 | D0G9YH | 0.278 | ||||
ENC003764 | 0.422 | D0V9WF | 0.276 |