|
Name |
Tryptoquivaline O
|
Molecular Formula | C23H18N4O5 | |
IUPAC Name* |
(2S,3aR,4S,4'R)-2-methyl-1,5'-dioxo-4'-(4-oxoquinazolin-3-yl)spiro[2,3a-dihydroimidazo[1,2-a]indole-4,2'-oxolane]-3-carbaldehyde
|
|
SMILES |
C[C@H]1C(=O)N2[C@@H](N1C=O)[C@]3(C[C@H](C(=O)O3)N4C=NC5=CC=CC=C5C4=O)C6=CC=CC=C62
|
|
InChI |
InChI=1S/C23H18N4O5/c1-13-19(29)27-17-9-5-3-7-15(17)23(22(27)26(13)12-28)10-18(21(31)32-23)25-11-24-16-8-4-2-6-14(16)20(25)30/h2-9,11-13,18,22H,10H2,1H3/t13-,18+,22+,23-/m0/s1
|
|
InChIKey |
VTWNCGVXAGXDKJ-LJQJNQQPSA-N
|
|
Synonyms |
TRYPTOQUIVALINE O
|
|
CAS | NA | |
PubChem CID | 57407879 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 430.4 | ALogp: | 1.3 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.6 | Aromatic Rings: | 6 |
Heavy Atoms: | 32 | QED Weighted: | 0.454 |
Caco-2 Permeability: | -5.461 | MDCK Permeability: | 0.00003740 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.076 |
Human Intestinal Absorption (HIA): | 0.139 | 20% Bioavailability (F20%): | 0.952 |
30% Bioavailability (F30%): | 0.99 |
Blood-Brain-Barrier Penetration (BBB): | 0.124 | Plasma Protein Binding (PPB): | 56.62% |
Volume Distribution (VD): | 0.72 | Fu: | 58.04% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.274 |
CYP2C19-inhibitor: | 0.068 | CYP2C19-substrate: | 0.365 |
CYP2C9-inhibitor: | 0.152 | CYP2C9-substrate: | 0.508 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.087 |
CYP3A4-inhibitor: | 0.183 | CYP3A4-substrate: | 0.93 |
Clearance (CL): | 5.645 | Half-life (T1/2): | 0.139 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.9 |
Drug-inuced Liver Injury (DILI): | 0.989 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.147 | Maximum Recommended Daily Dose: | 0.06 |
Skin Sensitization: | 0.804 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.409 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000977 | 0.752 | D0B1FE | 0.290 | ||||
ENC002357 | 0.692 | D0DV3O | 0.289 | ||||
ENC003647 | 0.616 | D08FTG | 0.284 | ||||
ENC003203 | 0.539 | D0QL3P | 0.283 | ||||
ENC001948 | 0.521 | D0QV5T | 0.280 | ||||
ENC004162 | 0.471 | D0E3OF | 0.279 | ||||
ENC002127 | 0.426 | D07VHR | 0.276 | ||||
ENC002409 | 0.420 | D0R6RO | 0.271 | ||||
ENC003601 | 0.391 | D05MQK | 0.268 | ||||
ENC002940 | 0.368 | D07GXR | 0.267 |