|
Name |
Isotryptoquivaline F
|
Molecular Formula | C22H18N4O4 | |
IUPAC Name* |
(2R,3aR,4R)-5'-hydroxy-2-methyl-4'-(4-oxoquinazolin-3-yl)spiro[3,3a-dihydro-2H-imidazo[1,2-a]indole-4,2'-3H-furan]-1-one
|
|
SMILES |
C[C@@H]1C(=O)N2[C@@H](N1)[C@@]3(CC(=C(O3)O)N4C=NC5=CC=CC=C5C4=O)C6=CC=CC=C62
|
|
InChI |
InChI=1S/C22H18N4O4/c1-12-18(27)26-16-9-5-3-7-14(16)22(21(26)24-12)10-17(20(29)30-22)25-11-23-15-8-4-2-6-13(15)19(25)28/h2-9,11-12,21,24,29H,10H2,1H3/t12-,21-,22-/m1/s1
|
|
InChIKey |
HHUOPWWDNFTKHB-ZWVWPOJTSA-N
|
|
Synonyms |
Isotryptoquivaline F
|
|
CAS | NA | |
PubChem CID | 101898530 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 402.4 | ALogp: | 1.3 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.5 | Aromatic Rings: | 6 |
Heavy Atoms: | 30 | QED Weighted: | 0.65 |
Caco-2 Permeability: | -5.356 | MDCK Permeability: | 0.00002230 |
Pgp-inhibitor: | 0.581 | Pgp-substrate: | 0.015 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.353 |
30% Bioavailability (F30%): | 0.982 |
Blood-Brain-Barrier Penetration (BBB): | 0.101 | Plasma Protein Binding (PPB): | 54.05% |
Volume Distribution (VD): | 0.948 | Fu: | 60.88% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.452 |
CYP2C19-inhibitor: | 0.093 | CYP2C19-substrate: | 0.663 |
CYP2C9-inhibitor: | 0.12 | CYP2C9-substrate: | 0.507 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.187 |
CYP3A4-inhibitor: | 0.398 | CYP3A4-substrate: | 0.919 |
Clearance (CL): | 3.688 | Half-life (T1/2): | 0.245 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.977 |
Drug-inuced Liver Injury (DILI): | 0.986 | AMES Toxicity: | 0.036 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.923 |
Skin Sensitization: | 0.64 | Carcinogencity: | 0.059 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.145 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000977 | 0.703 | D0QV5T | 0.315 | ||||
ENC004162 | 0.602 | D0E3OF | 0.313 | ||||
ENC002868 | 0.539 | D02TJS | 0.308 | ||||
ENC002127 | 0.530 | D0B1FE | 0.304 | ||||
ENC002357 | 0.527 | D08FTG | 0.298 | ||||
ENC002409 | 0.521 | D0QL3P | 0.296 | ||||
ENC003647 | 0.492 | D0V9WF | 0.293 | ||||
ENC001948 | 0.455 | D0DV3O | 0.291 | ||||
ENC005478 | 0.402 | D07VHR | 0.288 | ||||
ENC001979 | 0.402 | D05MQK | 0.288 |