|
Name |
Aniquinazoline A
|
Molecular Formula | C27H29N5O4 | |
IUPAC Name* |
(1R,12R,14S)-12,14-dimethyl-14-[(2R,4S)-5-oxo-1-phenyl-4-propan-2-ylimidazolidin-2-yl]-13-oxa-2,10,17-triazatetracyclo[10.3.2.02,11.04,9]heptadeca-4,6,8,10-tetraene-3,16-dione
|
|
SMILES |
CC(C)[C@H]1C(=O)N([C@@H](N1)[C@@]2(C[C@@H]3C(=O)N[C@](O2)(C4=NC5=CC=CC=C5C(=O)N34)C)C)C6=CC=CC=C6
|
|
InChI |
InChI=1S/C27H29N5O4/c1-15(2)20-23(35)31(16-10-6-5-7-11-16)24(29-20)26(3)14-19-21(33)30-27(4,36-26)25-28-18-13-9-8-12-17(18)22(34)32(19)25/h5-13,15,19-20,24,29H,14H2,1-4H3,(H,30,33)/t19-,20+,24-,26+,27-/m1/s1
|
|
InChIKey |
YSCMNYAXBOTDDQ-MGYYBZJHSA-N
|
|
Synonyms |
Aniquinazoline A
|
|
CAS | NA | |
PubChem CID | 139583876 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 487.5 | ALogp: | 2.6 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 103.0 | Aromatic Rings: | 7 |
Heavy Atoms: | 36 | QED Weighted: | 0.588 |
Caco-2 Permeability: | -5.298 | MDCK Permeability: | 0.00002350 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.074 |
Human Intestinal Absorption (HIA): | 0.224 | 20% Bioavailability (F20%): | 0.546 |
30% Bioavailability (F30%): | 0.969 |
Blood-Brain-Barrier Penetration (BBB): | 0.048 | Plasma Protein Binding (PPB): | 71.68% |
Volume Distribution (VD): | 0.915 | Fu: | 27.29% |
CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.781 |
CYP2C19-inhibitor: | 0.175 | CYP2C19-substrate: | 0.824 |
CYP2C9-inhibitor: | 0.757 | CYP2C9-substrate: | 0.105 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.156 |
CYP3A4-inhibitor: | 0.893 | CYP3A4-substrate: | 0.93 |
Clearance (CL): | 7.127 | Half-life (T1/2): | 0.422 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.964 |
Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.081 | Maximum Recommended Daily Dose: | 0.815 |
Skin Sensitization: | 0.189 | Carcinogencity: | 0.863 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.6 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003764 | 0.637 | D0B1FE | 0.321 | ||||
ENC003666 | 0.583 | D07VHR | 0.305 | ||||
ENC001948 | 0.528 | D0J6WW | 0.290 | ||||
ENC002409 | 0.485 | D0E4DW | 0.289 | ||||
ENC006010 | 0.467 | D0QV5T | 0.288 | ||||
ENC004348 | 0.452 | D0E3OF | 0.287 | ||||
ENC000977 | 0.438 | D08FTG | 0.282 | ||||
ENC002127 | 0.437 | D0V9WF | 0.281 | ||||
ENC003647 | 0.436 | D09NNH | 0.279 | ||||
ENC004647 | 0.435 | D07NVU | 0.278 |