|
Name |
7-Isoprenylindole-3-carboxylic acid
|
Molecular Formula | C14H13NO2 | |
IUPAC Name* |
7-(3-methylbuta-1,3-dienyl)-1H-indole-3-carboxylic acid
|
|
SMILES |
CC(=C)C=CC1=C2C(=CC=C1)C(=CN2)C(=O)O
|
|
InChI |
InChI=1S/C14H13NO2/c1-9(2)6-7-10-4-3-5-11-12(14(16)17)8-15-13(10)11/h3-8,15H,1H2,2H3,(H,16,17)
|
|
InChIKey |
BSWNMFJNJWKJJF-UHFFFAOYSA-N
|
|
Synonyms |
7-isoprenylindole-3-carboxylic acid
|
|
CAS | NA | |
PubChem CID | 129830957 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 227.26 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 53.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.772 |
Caco-2 Permeability: | -4.928 | MDCK Permeability: | 0.00001340 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.467 | Plasma Protein Binding (PPB): | 92.15% |
Volume Distribution (VD): | 0.696 | Fu: | 3.58% |
CYP1A2-inhibitor: | 0.408 | CYP1A2-substrate: | 0.547 |
CYP2C19-inhibitor: | 0.144 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.572 | CYP2C9-substrate: | 0.486 |
CYP2D6-inhibitor: | 0.266 | CYP2D6-substrate: | 0.278 |
CYP3A4-inhibitor: | 0.036 | CYP3A4-substrate: | 0.136 |
Clearance (CL): | 2.167 | Half-life (T1/2): | 0.894 |
hERG Blockers: | 0.104 | Human Hepatotoxicity (H-HT): | 0.882 |
Drug-inuced Liver Injury (DILI): | 0.969 | AMES Toxicity: | 0.036 |
Rat Oral Acute Toxicity: | 0.975 | Maximum Recommended Daily Dose: | 0.718 |
Skin Sensitization: | 0.925 | Carcinogencity: | 0.215 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.849 |
Respiratory Toxicity: | 0.965 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002914 | 0.621 | D0GY5Z | 0.323 | ||||
ENC005757 | 0.446 | D07HBX | 0.298 | ||||
ENC001547 | 0.356 | D05EJG | 0.290 | ||||
ENC006005 | 0.346 | D0E6OC | 0.281 | ||||
ENC001774 | 0.343 | D01ZJK | 0.279 | ||||
ENC000999 | 0.333 | D09SOA | 0.276 | ||||
ENC001345 | 0.333 | D05FTJ | 0.276 | ||||
ENC000118 | 0.333 | D0C4YC | 0.267 | ||||
ENC004871 | 0.333 | D01WJL | 0.267 | ||||
ENC001448 | 0.323 | D0V9EN | 0.262 |