|
Name |
(2S)-2-ethylhexan-1-ol
|
Molecular Formula | C8H18O | |
IUPAC Name* |
(2S)-2-ethylhexan-1-ol
|
|
SMILES |
CCCC[C@H](CC)CO
|
|
InChI |
InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/t8-/m0/s1
|
|
InChIKey |
YIWUKEYIRIRTPP-QMMMGPOBSA-N
|
|
Synonyms |
(2S)-2-ethylhexan-1-ol; 2EH; s(+)2-ethylhexanol; (s)-2-ethyl-1-hexanol; (S)-2-Ethylhexan-1-ol; QSPL 012; SCHEMBL9492501; ZINC1529452; Q27452941
|
|
CAS | NA | |
PubChem CID | 6991980 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 130.23 | ALogp: | 3.1 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.606 |
Caco-2 Permeability: | -4.184 | MDCK Permeability: | 0.00002360 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.05 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.407 |
30% Bioavailability (F30%): | 0.483 |
Blood-Brain-Barrier Penetration (BBB): | 0.907 | Plasma Protein Binding (PPB): | 59.42% |
Volume Distribution (VD): | 0.891 | Fu: | 40.82% |
CYP1A2-inhibitor: | 0.744 | CYP1A2-substrate: | 0.842 |
CYP2C19-inhibitor: | 0.082 | CYP2C19-substrate: | 0.492 |
CYP2C9-inhibitor: | 0.105 | CYP2C9-substrate: | 0.349 |
CYP2D6-inhibitor: | 0.311 | CYP2D6-substrate: | 0.24 |
CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.145 |
Clearance (CL): | 9.501 | Half-life (T1/2): | 0.739 |
hERG Blockers: | 0.041 | Human Hepatotoxicity (H-HT): | 0.07 |
Drug-inuced Liver Injury (DILI): | 0.036 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.043 |
Skin Sensitization: | 0.723 | Carcinogencity: | 0.228 |
Eye Corrosion: | 0.976 | Eye Irritation: | 0.989 |
Respiratory Toxicity: | 0.427 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000220 | 1.000 | D0Y3KG | 0.316 | ||||
ENC000211 | 0.514 | D08QME | 0.292 | ||||
ENC000398 | 0.500 | D0X4FM | 0.253 | ||||
ENC000212 | 0.475 | D01QLH | 0.243 | ||||
ENC000306 | 0.471 | D0HR8Z | 0.208 | ||||
ENC001126 | 0.462 | D0O3AB | 0.208 | ||||
ENC000506 | 0.455 | D03LGY | 0.203 | ||||
ENC001248 | 0.439 | D08SJZ | 0.200 | ||||
ENC001235 | 0.435 | D00AMQ | 0.200 | ||||
ENC000903 | 0.429 | D0CT4D | 0.185 |