|
Name |
2-Ethylhexanoic acid
|
Molecular Formula | C8H16O2 | |
IUPAC Name* |
2-ethylhexanoic acid
|
|
SMILES |
CCCCC(CC)C(=O)O
|
|
InChI |
InChI=1S/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)
|
|
InChIKey |
OBETXYAYXDNJHR-UHFFFAOYSA-N
|
|
Synonyms |
2-ETHYLHEXANOIC ACID; 149-57-5; 2-Ethylcaproic acid; Hexanoic acid, 2-ethyl-; Ethylhexanoic acid; Ethylhexoic acid; 2-Ethylhexoic acid; Butylethylacetic acid; 2-Butylbutanoic acid; 3-Heptanecarboxylic acid; Ethyl hexanoic acid; 2-ethyl-hexoic acid; 2-ethyl hexanoic acid; alpha-Ethylcaproic acid; 2-ethyl-hexanoic acid; Ethyl hexanoic acid, 2-; 2 ETHYL HEXANOIC ACID; alpha-ethyl caproic acid; .alpha.-Ethylcaproic acid; 2-Ethyl-1-hexanoic acid; (+/-)-2-ETHYLHEXANOIC ACID; 01MU2J7VVZ; 2-ETHYL HEXOIC ACID,AR; 61788-37-2; CHEBI:89058; NSC-8881; 2-ethylhexanoicacid; DSSTox_CID_5293; 2-Ethylhexansaeure; DSSTox_RID_77730; DSSTox_GSID_25293; 2-Ethylhexanoic acid, >=99%; 2-Ethylhexanoic acid, analytical standard; CAS-149-57-5; CCRIS 3348; HSDB 5649; Kyselina 2-ethylkapronova [Czech]; NSC 8881; Kyselina 2-ethylkapronova; EINECS 205-743-6; UNII-01MU2J7VVZ; Kyselina heptan-3-karboxylova [Czech]; BRN 1750468; Kyselina heptan-3-karboxylova; AI3-01371; Hexanoic acid, 2-ethyl-, (-)-; EINECS 262-971-9; MFCD00002675; 2-Ethylcapronic acid; 2-Ethyl-Hexonic acid; alpha-Ethylhexanoic acid; .alpha.-Ethylhexanoic acid; EC 205-743-6; SCHEMBL25800; 2-Ethylhexanoic acid, 99%; MLS002415695; CHEMBL1162485; DTXSID9025293; WLN: QVY4 & 2; NSC8881; HMS2267F21; STR05759; 2-ETHYLHEXANOIC ACID [HSDB]; Tox21_201406; Tox21_300108; LMFA01020087; AKOS009031416; AT29893; CS-W016381; SB44987; SB44994; Hexanoic acid,2-ethyl-, tridecyl ester; NCGC00091324-01; NCGC00091324-02; NCGC00091324-03; NCGC00253985-01; NCGC00258957-01; SMR001252268; E0120; FT-0612273; FT-0654390; EN300-20410; Q209384; W-109079; F0001-0703; Z104478072; 18FEB650-7573-4EA0-B0CD-9D8BED766547; 2-Ethylhexanoic acid, Pharmaceutical Secondary Standard; Certified Reference Material
|
|
CAS | 149-57-5 | |
PubChem CID | 8697 | |
ChEMBL ID | CHEMBL1162485 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 144.21 | ALogp: | 2.6 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 10 | QED Weighted: | 0.644 |
Caco-2 Permeability: | -4.443 | MDCK Permeability: | 0.00002870 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.022 |
Blood-Brain-Barrier Penetration (BBB): | 0.959 | Plasma Protein Binding (PPB): | 80.97% |
Volume Distribution (VD): | 0.376 | Fu: | 16.17% |
CYP1A2-inhibitor: | 0.059 | CYP1A2-substrate: | 0.771 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.813 |
CYP2C9-inhibitor: | 0.029 | CYP2C9-substrate: | 0.938 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.226 |
CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.06 |
Clearance (CL): | 3.657 | Half-life (T1/2): | 0.789 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.106 |
Drug-inuced Liver Injury (DILI): | 0.03 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.063 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.221 | Carcinogencity: | 0.131 |
Eye Corrosion: | 0.98 | Eye Irritation: | 0.991 |
Respiratory Toxicity: | 0.404 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000833 | 0.618 | D0Y3KG | 0.576 | ||||
ENC000652 | 0.568 | D03LGY | 0.317 | ||||
ENC000550 | 0.531 | D01OPV | 0.289 | ||||
ENC002444 | 0.526 | D03CHT | 0.279 | ||||
ENC001899 | 0.471 | D0A5JP | 0.273 | ||||
ENC000220 | 0.471 | D0F5DO | 0.267 | ||||
ENC000889 | 0.459 | D01QLH | 0.263 | ||||
ENC000890 | 0.459 | D09PUL | 0.258 | ||||
ENC000211 | 0.450 | D0EP8X | 0.257 | ||||
ENC000398 | 0.429 | D00WUF | 0.256 |