|
Name |
Homobutein
|
Molecular Formula | C16H14O5 | |
IUPAC Name* |
(E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one
|
|
SMILES |
COC1=C(C=CC(=C1)/C=C/C(=O)C2=C(C=C(C=C2)O)O)O
|
|
InChI |
InChI=1S/C16H14O5/c1-21-16-8-10(3-7-14(16)19)2-6-13(18)12-5-4-11(17)9-15(12)20/h2-9,17,19-20H,1H3/b6-2+
|
|
InChIKey |
BWFSBUVPIAIXKJ-QHHAFSJGSA-N
|
|
Synonyms |
Homobutein; 34000-39-0; (E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one; 2',4,4'-Trihydroxy-3-methoxychalcone; 21583-31-3; 3-Methoxy-2',4',4-trihydroxychalcone; 3-O-Methylbutein; EINECS 251-782-7; 1-(2,4-Dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-2-propen-1-one; 4,2',4'-Trihydroxy-3-methoxychalcone; (E)-2',4,4'-Trihydroxy-3-methoxychalcone; 4,2',4'-Trihydroxy-3-methoxy-trans-chalcone; SCHEMBL633521; CHEMBL144686; CHEBI:178323; DTXSID501318459; Acrylophenone, 2',4'-dihydroxy-3-(p-hydroxy-m-methoxyphenyl)-; HY-N8707; ZINC4252597; LMPK12120112; MFCD00016769; (2E)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one; 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-; CCG-208390; NCGC00163564-01; CS-0148953; SR-05000002283; SR-05000002283-2; 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-, (2E)-
|
|
CAS | 34000-39-0 | |
PubChem CID | 6438092 | |
ChEMBL ID | CHEMBL144686 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 286.28 | ALogp: | 3.1 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.591 |
Caco-2 Permeability: | -4.818 | MDCK Permeability: | 0.00001270 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.076 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.221 |
Blood-Brain-Barrier Penetration (BBB): | 0.07 | Plasma Protein Binding (PPB): | 99.81% |
Volume Distribution (VD): | 0.455 | Fu: | 0.99% |
CYP1A2-inhibitor: | 0.946 | CYP1A2-substrate: | 0.841 |
CYP2C19-inhibitor: | 0.553 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.677 | CYP2C9-substrate: | 0.914 |
CYP2D6-inhibitor: | 0.561 | CYP2D6-substrate: | 0.878 |
CYP3A4-inhibitor: | 0.87 | CYP3A4-substrate: | 0.225 |
Clearance (CL): | 13.124 | Half-life (T1/2): | 0.933 |
hERG Blockers: | 0.058 | Human Hepatotoxicity (H-HT): | 0.144 |
Drug-inuced Liver Injury (DILI): | 0.701 | AMES Toxicity: | 0.803 |
Rat Oral Acute Toxicity: | 0.744 | Maximum Recommended Daily Dose: | 0.835 |
Skin Sensitization: | 0.946 | Carcinogencity: | 0.658 |
Eye Corrosion: | 0.023 | Eye Irritation: | 0.95 |
Respiratory Toxicity: | 0.677 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002581 | 0.614 | D0V9EN | 0.431 | ||||
ENC001624 | 0.563 | D0E6OC | 0.404 | ||||
ENC001101 | 0.548 | D07MGA | 0.368 | ||||
ENC002584 | 0.532 | D00KRE | 0.341 | ||||
ENC001416 | 0.495 | D08LFZ | 0.338 | ||||
ENC005410 | 0.471 | D0E9CD | 0.333 | ||||
ENC004624 | 0.456 | D0KN2M | 0.325 | ||||
ENC002499 | 0.442 | D0AZ8C | 0.322 | ||||
ENC001579 | 0.433 | D04AIT | 0.318 | ||||
ENC002913 | 0.431 | D0Y7PG | 0.318 |