|
Name |
Calebin A
|
Molecular Formula | C21H20O7 | |
IUPAC Name* |
[(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
|
|
SMILES |
COC1=C(C=CC(=C1)/C=C/C(=O)COC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O
|
|
InChI |
InChI=1S/C21H20O7/c1-26-19-11-14(4-8-17(19)23)3-7-16(22)13-28-21(25)10-6-15-5-9-18(24)20(12-15)27-2/h3-12,23-24H,13H2,1-2H3/b7-3+,10-6+
|
|
InChIKey |
UYEWRTKHKAVRDI-ASVGJQBISA-N
|
|
Synonyms |
Calebin A; Calebin-A; 336784-82-8; U2M09W0E67; [(E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate; 2-propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (3E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxo-3-butenyl ester, (2E)-; (E)-(E)-4-(4-Hydroxy-3-methoxyphenyl)-2-oxobut-3-en-1-yl 3-(4-hydroxy-3-methoxyphenyl)acrylate; 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (3E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxo-3-buten-1-yl ester, (2E)-; CHEMBL86075; UNII-U2M09W0E67; SCHEMBL1231185; CHEBI:175904; DTXSID201318662; (3E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-en-1-yl (2E)-3-(4-hydroxy-3-methoxyphenyl)acrylate; (3E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-en-1-yl (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate; 3-(4-Hydroxy-3-methoxy-phenyl)-acrylic acid 4-(4-hydroxy-3-methoxy-phenyl)-2-oxo-but-3-enyl ester; 4''-(3'''-Methoxy-4'''-hydroxyphenyl)-2''-oxo-3''-enebutanyl 3-(3'-methoxy-4'-hydroxyphenyl)propenoate; 4''-(3'''-Methoxy-4'''-hydroxyphenyl)-2''-oxo-3''-enebutanyl-3-(3'-methoxy-4'-hydroxyphenyl)propenoate
|
|
CAS | 336784-82-8 | |
PubChem CID | 637429 | |
ChEMBL ID | CHEMBL86075 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 384.4 | ALogp: | 3.3 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 28 | QED Weighted: | 0.528 |
Caco-2 Permeability: | -4.842 | MDCK Permeability: | 0.00001830 |
Pgp-inhibitor: | 0.339 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.182 | 20% Bioavailability (F20%): | 0.975 |
30% Bioavailability (F30%): | 0.976 |
Blood-Brain-Barrier Penetration (BBB): | 0.246 | Plasma Protein Binding (PPB): | 99.97% |
Volume Distribution (VD): | 0.395 | Fu: | 1.62% |
CYP1A2-inhibitor: | 0.858 | CYP1A2-substrate: | 0.839 |
CYP2C19-inhibitor: | 0.603 | CYP2C19-substrate: | 0.107 |
CYP2C9-inhibitor: | 0.767 | CYP2C9-substrate: | 0.918 |
CYP2D6-inhibitor: | 0.156 | CYP2D6-substrate: | 0.903 |
CYP3A4-inhibitor: | 0.766 | CYP3A4-substrate: | 0.549 |
Clearance (CL): | 12.621 | Half-life (T1/2): | 0.957 |
hERG Blockers: | 0.12 | Human Hepatotoxicity (H-HT): | 0.414 |
Drug-inuced Liver Injury (DILI): | 0.887 | AMES Toxicity: | 0.463 |
Rat Oral Acute Toxicity: | 0.77 | Maximum Recommended Daily Dose: | 0.854 |
Skin Sensitization: | 0.952 | Carcinogencity: | 0.657 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.228 |
Respiratory Toxicity: | 0.545 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001848 | 0.495 | D0E6OC | 0.436 | ||||
ENC001624 | 0.424 | D0KN2M | 0.409 | ||||
ENC001579 | 0.419 | D06BLQ | 0.318 | ||||
ENC001101 | 0.415 | D0V9EN | 0.314 | ||||
ENC002388 | 0.382 | D00KRE | 0.302 | ||||
ENC002583 | 0.369 | D06GCK | 0.301 | ||||
ENC002269 | 0.367 | D0F4ZY | 0.292 | ||||
ENC001578 | 0.364 | D0A8FB | 0.289 | ||||
ENC001961 | 0.362 | D0Q9ON | 0.288 | ||||
ENC004820 | 0.362 | D01SAT | 0.274 |