|
Name |
Isojasmone
|
Molecular Formula | C11H16O | |
IUPAC Name* |
2-methyl-3-[(E)-pent-2-enyl]cyclopent-2-en-1-one
|
|
SMILES |
CC/C=C/CC1=C(C(=O)CC1)C
|
|
InChI |
InChI=1S/C11H16O/c1-3-4-5-6-10-7-8-11(12)9(10)2/h4-5H,3,6-8H2,1-2H3/b5-4+
|
|
InChIKey |
GVONPEQEUQYVNH-SNAWJCMRSA-N
|
|
Synonyms |
Isojasmone; 11050-62-7; 2-Methyl-3-(2-pentenyl)-2-cyclopenten-1-one; 2-Cyclopenten-1-one, 2-methyl-3-(2-pentenyl)-; 2-methyl-3-[(E)-pent-2-enyl]cyclopent-2-en-1-one; TY8GSG1D56; 2-Methyl-3-pent-2-enylcyclopent-2-enone; 2-Cyclopenten-1-one, 2-methyl-3-(2-penten-1-yl)-; Isojasmone (natural); 2-Methyl-3-(2-penten-1-yl)-2-Cyclopenten-1-one; EINECS 234-273-4; 2-METHYL-3-((E)-PENT-2-ENYL)CYCLOPENT-2-EN-1-ONE; UNII-TY8GSG1D56; SCHEMBL1235273; CHEBI:189993; 152982-57-5
|
|
CAS | 11050-62-7 | |
PubChem CID | 6435841 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 164.24 | ALogp: | 2.2 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.58 |
Caco-2 Permeability: | -4.466 | MDCK Permeability: | 0.00002470 |
Pgp-inhibitor: | 0.474 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.972 | Plasma Protein Binding (PPB): | 90.82% |
Volume Distribution (VD): | 1.076 | Fu: | 8.23% |
CYP1A2-inhibitor: | 0.115 | CYP1A2-substrate: | 0.396 |
CYP2C19-inhibitor: | 0.049 | CYP2C19-substrate: | 0.889 |
CYP2C9-inhibitor: | 0.035 | CYP2C9-substrate: | 0.599 |
CYP2D6-inhibitor: | 0.054 | CYP2D6-substrate: | 0.884 |
CYP3A4-inhibitor: | 0.033 | CYP3A4-substrate: | 0.367 |
Clearance (CL): | 1.592 | Half-life (T1/2): | 0.765 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.145 |
Drug-inuced Liver Injury (DILI): | 0.078 | AMES Toxicity: | 0.109 |
Rat Oral Acute Toxicity: | 0.594 | Maximum Recommended Daily Dose: | 0.845 |
Skin Sensitization: | 0.823 | Carcinogencity: | 0.893 |
Eye Corrosion: | 0.182 | Eye Irritation: | 0.857 |
Respiratory Toxicity: | 0.714 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001459 | 0.650 | D0H6VY | 0.190 | ||||
ENC000476 | 0.421 | D09TPF | 0.184 | ||||
ENC002343 | 0.326 | D00IUG | 0.182 | ||||
ENC005598 | 0.305 | D0Q4XQ | 0.180 | ||||
ENC001581 | 0.305 | D05OQJ | 0.175 | ||||
ENC001746 | 0.300 | D0E0WQ | 0.175 | ||||
ENC002751 | 0.264 | D0W0MF | 0.172 | ||||
ENC005984 | 0.262 | D02OZY | 0.169 | ||||
ENC006016 | 0.246 | D03GCJ | 0.167 | ||||
ENC004598 | 0.246 | D00MIN | 0.167 |