|
Name |
1-(4-Amino-2-hydroxyphenyl)ethanone
|
Molecular Formula | C8H9NO2 | |
IUPAC Name* |
1-(4-amino-2-hydroxyphenyl)ethanone
|
|
SMILES |
CC(=O)C1=C(C=C(C=C1)N)O
|
|
InChI |
InChI=1S/C8H9NO2/c1-5(10)7-3-2-6(9)4-8(7)11/h2-4,11H,9H2,1H3
|
|
InChIKey |
QQZFVONVJPXCSQ-UHFFFAOYSA-N
|
|
Synonyms |
1-(4-amino-2-hydroxyphenyl)ethanone; 2476-29-1; 1-(4-AMINO-2-HYDROXYPHENYL)ETHAN-1-ONE; 4'-Amino-2'-hydroxyacetophenone; 1-(4-Amino-2-hydroxyphenyl)ethane-1-one; Ethanone, 1-(4-amino-2-hydroxyphenyl)-; MFCD00100636; 4 inverted exclamation mark -Amino-2 inverted exclamation mark -hydroxyacetophenone; DSJ; 2-acetyl-5-aminophenol; SCHEMBL615576; Amino-2-hydroxyphenyl)ethanone; DTXSID30332629; ZINC157818; AMY12170; BBL028202; STK929155; AKOS005659177; CS-W005109; DS-0851; PS-4191; SB75739; SY009074; DB-005049; FT-0602713; 476A291; A848118; W-206910; 1-(4-amino-2-hydroxyphenyl)ethan-1-one, AldrichCPR; F0001-0837; 4'-Amino-2'-hydroxyacetophenone;1-(4-Amino-2-hydroxyphenyl)ethane-1-one
|
|
CAS | 2476-29-1 | |
PubChem CID | 459296 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 151.16 | ALogp: | 1.3 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.473 |
Caco-2 Permeability: | -4.426 | MDCK Permeability: | 0.00001110 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.974 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.957 |
Blood-Brain-Barrier Penetration (BBB): | 0.375 | Plasma Protein Binding (PPB): | 65.33% |
Volume Distribution (VD): | 1.166 | Fu: | 58.61% |
CYP1A2-inhibitor: | 0.881 | CYP1A2-substrate: | 0.393 |
CYP2C19-inhibitor: | 0.354 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.34 | CYP2C9-substrate: | 0.685 |
CYP2D6-inhibitor: | 0.213 | CYP2D6-substrate: | 0.573 |
CYP3A4-inhibitor: | 0.295 | CYP3A4-substrate: | 0.193 |
Clearance (CL): | 9.312 | Half-life (T1/2): | 0.563 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.102 |
Drug-inuced Liver Injury (DILI): | 0.382 | AMES Toxicity: | 0.653 |
Rat Oral Acute Toxicity: | 0.163 | Maximum Recommended Daily Dose: | 0.032 |
Skin Sensitization: | 0.678 | Carcinogencity: | 0.214 |
Eye Corrosion: | 0.374 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.961 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000103 | 0.568 | D01WJL | 0.706 | ||||
ENC000344 | 0.526 | D0S2BT | 0.686 | ||||
ENC000069 | 0.450 | D0C4YC | 0.568 | ||||
ENC000690 | 0.415 | D0L5PO | 0.453 | ||||
ENC001055 | 0.386 | D07NAJ | 0.345 | ||||
ENC001056 | 0.386 | D07HBX | 0.333 | ||||
ENC000097 | 0.381 | D0BA6T | 0.333 | ||||
ENC004624 | 0.373 | D0U0OT | 0.327 | ||||
ENC000200 | 0.366 | D08HVR | 0.320 | ||||
ENC000108 | 0.366 | D0M4VM | 0.320 |