|
Name |
trans,trans-Farnesol
|
Molecular Formula | C15H26O | |
IUPAC Name* |
(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol
|
|
SMILES |
CC(=CCC/C(=C/CC/C(=C/CO)/C)/C)C
|
|
InChI |
InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+
|
|
InChIKey |
CRDAMVZIKSXKFV-YFVJMOTDSA-N
|
|
Synonyms |
farnesol; trans,trans-Farnesol; 106-28-5; (E,E)-Farnesol; (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol; 4602-84-0; trans-Farnesol; (2E,6E)-Farnesol; 2-trans,6-trans-Farnesol; All-trans-Farnesol; Farnesyl alcohol; 3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol; Inhibitor A2; FCI 119a; 2,6-Di-trans-Farnesol; (E)-farnesol; 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-; (2-trans,6-trans)-farnesol; HSDB 445; 2,6,10-dodecatrien-1-ol, 3,7,11-trimethyl-, (2E,6E)-; 2E,6E-farnesol; 3,7,11-Trimethyl-2,6,10-dodecatrienol; 3,7,11-trimethyldodeca-2,6,10-trien-1-ol; Floral Green; CHEBI:16619; X23PI60R17; (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol; 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, (E,E)-; Farnesol 97+% FCC; MFCD00002918; FEMA No. 2478; Trimethyl dodecatrienol; EINECS 225-004-1; UNII-EB41QIU6JL; NSC 60597; EPA Pesticide Chemical Code 128911; transfarnesol; Nikkosome; UNII-X23PI60R17; trans- farnesol; AI3-44561; .beta.-Farnesol; E,E-farnesol; all-trans farnesol; (E,E)farnesol; FOF; trans,trans farnesol; Farnesol (6CI); (E,E,)-farnesol; Farnesol, 95%; (2Z,6Z)-Farnesol; ALL-E-FARNESOL; Farnesol (2E,6E); Farnesol, (E,E)-; Farnesol, trans, trans; ST072172; 2E,6E-Farnesyl alcohol; FARNESOL (TRANS); Spectrum5_002027; trans,trans-alpha-farnesol; EB41QIU6JL; DSSTox_CID_12389; DSSTox_RID_78934; trans,trans-Farnesol, 96%; trans,trans-Farnesol, 97%; DSSTox_GSID_32389; SCHEMBL58068; 2-trans-S-6-trans-farnesol; BSPBio_002660; Farnesol, analytical standard; CHEMBL25308; SPECTRUM1501022; (E)-.BETA.-FARNESOL; (E,E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol; DTXSID2040789; BDBM11021; CHEBI:26199; CHEBI:28600; FARNESOL, (2E,6E)-; HY-Y0248A; trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol; AMY33538; BCP22704; ZINC1532860; Tox21_302034; AC-422; BBL027412; CCG-38862; s4941; STL372743; AKOS004907430; LMPR0103010001; NCGC00095654-01; NCGC00095654-02; NCGC00095654-03; NCGC00095654-04; NCGC00095654-05; NCGC00255293-01; trans,trans-Farnesol, analytical standard; AS-16107; LS-14447; CAS-4602-84-0; FARNESOL TRANS,TRANS-FARNESOL [MI]; CS-0031456; FEMA NO. 2478, (2E,6E)-; T0608; 06F285; C01126; EN300-1692687; A801411; Q420449; Q-201851; W-109985; BRD-K24656285-001-01-0; (2E, 6E)-3,7,11-trimethyl2,6,10-dodecatrien-1-ol; (E,E,)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol; F1905-7040; Z2315575130; (2E,6E)-3,7,11-trimethyl-dodeca-2,6,10-trien-1-ol; (E,E)-3,7,11-TRIMETHYL-2,6,10-DODECATNEN-1-OL; 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl- (8CI,9CI); A2865747-EC66-4B9C-A593-0A066A438904; (2-trans,6-trans)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol; 3,7,11-TRIMETHYLDODECA-2-TRANS,6-TRANS,10-TRIEN-1-OL; trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol, (E,E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol
|
|
CAS | 4602-84-0 | |
PubChem CID | 445070 | |
ChEMBL ID | CHEMBL25308 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.37 | ALogp: | 4.8 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 16 | QED Weighted: | 0.606 |
Caco-2 Permeability: | -4.481 | MDCK Permeability: | 0.00002580 |
Pgp-inhibitor: | 0.551 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.738 |
30% Bioavailability (F30%): | 0.482 |
Blood-Brain-Barrier Penetration (BBB): | 0.963 | Plasma Protein Binding (PPB): | 97.06% |
Volume Distribution (VD): | 2.2 | Fu: | 3.03% |
CYP1A2-inhibitor: | 0.682 | CYP1A2-substrate: | 0.246 |
CYP2C19-inhibitor: | 0.186 | CYP2C19-substrate: | 0.118 |
CYP2C9-inhibitor: | 0.176 | CYP2C9-substrate: | 0.854 |
CYP2D6-inhibitor: | 0.304 | CYP2D6-substrate: | 0.164 |
CYP3A4-inhibitor: | 0.094 | CYP3A4-substrate: | 0.187 |
Clearance (CL): | 8.362 | Half-life (T1/2): | 0.67 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.701 |
Drug-inuced Liver Injury (DILI): | 0.012 | AMES Toxicity: | 0.001 |
Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.486 |
Skin Sensitization: | 0.967 | Carcinogencity: | 0.028 |
Eye Corrosion: | 0.371 | Eye Irritation: | 0.964 |
Respiratory Toxicity: | 0.011 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001462 | 1.000 | D05XQE | 0.717 | ||||
ENC002413 | 0.686 | D09XWD | 0.543 | ||||
ENC001717 | 0.686 | D03VFL | 0.476 | ||||
ENC001466 | 0.679 | D0M1PQ | 0.278 | ||||
ENC001464 | 0.679 | D01ZUA | 0.213 | ||||
ENC001465 | 0.679 | D0S7WX | 0.205 | ||||
ENC001467 | 0.667 | D06BLQ | 0.195 | ||||
ENC001716 | 0.650 | D0X7XG | 0.174 | ||||
ENC000314 | 0.545 | D0UE9X | 0.163 | ||||
ENC001606 | 0.545 | D04FBR | 0.161 |