|
Name |
3-Phosphoglyceric acid
|
Molecular Formula | C3H7O7P | |
IUPAC Name* |
(2R)-2-hydroxy-3-phosphonooxypropanoic acid
|
|
SMILES |
C([C@H](C(=O)O)O)OP(=O)(O)O
|
|
InChI |
InChI=1S/C3H7O7P/c4-2(3(5)6)1-10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9)/t2-/m1/s1
|
|
InChIKey |
OSJPPGNTCRNQQC-UWTATZPHSA-N
|
|
Synonyms |
3-phospho-D-glycerate; 3-phosphoglyceric acid; D-Glycerate 3-phosphate; 3-phospho-D-glyceric acid; 3-phospho-(R)-glycerate; CHEBI:17794; (2R)-2-hydroxy-3-(phosphonooxy)propanoic acid; 3443-58-1; 2-D-Hydroxy-3-phosphonooxy-propanoic acid; 3PG; D-(-)-3-Phosphoglyceric acid; 1iih; bmse000007; SCHEMBL2497743; CHEMBL1160563; DTXSID40862427; ZINC3869934; BDBM50216218; DB04510; C00197; Q223118; HG3
|
|
CAS | 820-11-1 | |
PubChem CID | 439183 | |
ChEMBL ID | CHEMBL1160563 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 186.06 | ALogp: | -2.6 |
HBD: | 4 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 124.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 11 | QED Weighted: | 0.418 |
Caco-2 Permeability: | -5.791 | MDCK Permeability: | 0.00663441 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.088 |
Human Intestinal Absorption (HIA): | 0.135 | 20% Bioavailability (F20%): | 0.74 |
30% Bioavailability (F30%): | 0.91 |
Blood-Brain-Barrier Penetration (BBB): | 0.707 | Plasma Protein Binding (PPB): | 11.15% |
Volume Distribution (VD): | 0.349 | Fu: | 90.52% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.063 |
CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.045 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.18 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.12 |
CYP3A4-inhibitor: | 0.004 | CYP3A4-substrate: | 0.008 |
Clearance (CL): | 1.403 | Half-life (T1/2): | 0.925 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.079 |
Drug-inuced Liver Injury (DILI): | 0.229 | AMES Toxicity: | 0.172 |
Rat Oral Acute Toxicity: | 0.011 | Maximum Recommended Daily Dose: | 0.476 |
Skin Sensitization: | 0.798 | Carcinogencity: | 0.185 |
Eye Corrosion: | 0.603 | Eye Irritation: | 0.991 |
Respiratory Toxicity: | 0.677 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000037 | 0.290 | D0B4KH | 0.297 | ||||
ENC000031 | 0.257 | D08QGD | 0.281 | ||||
ENC005511 | 0.250 | D0N3UL | 0.280 | ||||
ENC000824 | 0.243 | D02UDJ | 0.257 | ||||
ENC002070 | 0.238 | D06JGH | 0.255 | ||||
ENC001215 | 0.238 | D00HNB | 0.238 | ||||
ENC000465 | 0.233 | D00ENY | 0.238 | ||||
ENC000795 | 0.222 | D00NNC | 0.238 | ||||
ENC000289 | 0.222 | D06QDR | 0.236 | ||||
ENC000890 | 0.222 | D0BF8G | 0.234 |