|
Name |
Diisooctyl phthalate
|
Molecular Formula | C24H38O4 | |
IUPAC Name* |
bis(6-methylheptyl) benzene-1,2-dicarboxylate
|
|
SMILES |
CC(C)CCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC(C)C
|
|
InChI |
InChI=1S/C24H38O4/c1-19(2)13-7-5-11-17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-12-6-8-14-20(3)4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3
|
|
InChIKey |
IJFPVINAQGWBRJ-UHFFFAOYSA-N
|
|
Synonyms |
Diisooctyl phthalate; Bis(6-methylheptyl) phthalate; 27554-26-3; Isooctyl phthalate; Di-iso-octyl phthalate; 131-20-4; Phthalic acid, diisooctyl ester; Corflex 880; Flexol Plasticizer DIOP; bis(6-methylheptyl) benzene-1,2-dicarboxylate; Diisooctyl 1,2-benzenedicarboxylate; 1,2-Benzenedicarboxylic acid, diisooctyl ester; Phthalic acid, bis(6-methylheptyl)ester; CHEBI:34710; 6A121LGB40; Hexaplas M/O; 1,2-Benzenedicarboxylic acid, 1,2-diisooctyl ester; HSDB 588; NSC 6381; EINECS 248-523-5; AI3-27697-X (USDA); UNII-6A121LGB40; HEXAPLAS DIOP; JAYFLEX DIOP; DSSTox_CID_7933; Hexaplas M/O (Salt/Mix); DSSTox_RID_78618; DSSTox_GSID_27933; DIISOOCTYL O-PHTHALATE; BIDD:ER0438; SCHEMBL109014; QSPL 045; QSPL 083; 1,2-Benzenedicarboxylic acid, bis(6-methylheptyl) ester; CHEMBL3186540; UNEM 5005; DTXSID50873226; Phthalic Acid Di-iso-Octyl Ester; Phthalic acid bis(6-methylheptyl); DIISOOCTYL PHTHALATE [HSDB]; CBA55426; NSC-6381; ZINC4655188; Tox21_200466; MFCD00036241; AKOS015916164; Phthalic acid, bis-6-methylheptyl ester; NCGC00248637-01; NCGC00258020-01; AS-17769; CAS-27554-26-3; CS-0154229; FT-0624988; 1,2-Benzenedicarboxylic acid,diisooctyl ester; 1,2Benzenedicarboxylic acid, diisooctyl ester; Phthalic acid, bis-isooctyl ester (technical); D70235; Q2532970; 1,2-Benzenedicarboxylic acid, 1,1'-(2,2-dimethyl-1,3-propanediyl) 2,2'-diisooctyl ester; 1,2-Benzenedicarboxylic Acid, 1,2-bis(6-Methylheptyl) Ester;1,2-Benzenedicarboxylic Acid bis(6-Methylheptyl) Ester
|
|
CAS | 27554-26-3 | |
PubChem CID | 33934 | |
ChEMBL ID | CHEMBL3186540 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 390.6 | ALogp: | 8.5 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 28 | QED Weighted: | 0.272 |
Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00001830 |
Pgp-inhibitor: | 0.968 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.988 |
30% Bioavailability (F30%): | 0.956 |
Blood-Brain-Barrier Penetration (BBB): | 0.013 | Plasma Protein Binding (PPB): | 97.63% |
Volume Distribution (VD): | 1.445 | Fu: | 1.57% |
CYP1A2-inhibitor: | 0.134 | CYP1A2-substrate: | 0.178 |
CYP2C19-inhibitor: | 0.699 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.36 | CYP2C9-substrate: | 0.878 |
CYP2D6-inhibitor: | 0.116 | CYP2D6-substrate: | 0.022 |
CYP3A4-inhibitor: | 0.254 | CYP3A4-substrate: | 0.088 |
Clearance (CL): | 9.241 | Half-life (T1/2): | 0.044 |
hERG Blockers: | 0.18 | Human Hepatotoxicity (H-HT): | 0.003 |
Drug-inuced Liver Injury (DILI): | 0.367 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.933 | Carcinogencity: | 0.334 |
Eye Corrosion: | 0.02 | Eye Irritation: | 0.98 |
Respiratory Toxicity: | 0.052 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000669 | 0.678 | D0K8CI | 0.380 | ||||
ENC001801 | 0.667 | D0G2KD | 0.346 | ||||
ENC000164 | 0.634 | D00FSV | 0.320 | ||||
ENC000291 | 0.612 | D0D9NY | 0.306 | ||||
ENC000156 | 0.577 | D0P1RL | 0.296 | ||||
ENC000090 | 0.558 | D0OR6A | 0.293 | ||||
ENC000586 | 0.547 | D06ORU | 0.284 | ||||
ENC000155 | 0.535 | D0E7PQ | 0.282 | ||||
ENC005690 | 0.535 | D0L5YV | 0.279 | ||||
ENC001800 | 0.527 | D05LQX | 0.277 |