|
Name |
1-Octen-3-OL
|
Molecular Formula | C8H16O | |
IUPAC Name* |
oct-1-en-3-ol
|
|
SMILES |
CCCCCC(C=C)O
|
|
InChI |
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3
|
|
InChIKey |
VSMOENVRRABVKN-UHFFFAOYSA-N
|
|
Synonyms |
1-OCTEN-3-OL; Oct-1-en-3-ol; 3391-86-4; 1-Vinylhexanol; Vinyl amyl carbinol; 3-Hydroxy-1-octene; Amyl vinyl carbinol; Mushroom alcohol; Pentyl vinyl carbinol; Octen-3-ol; Matsuica alcohol; Matsutake alcohol; Vinyl hexanol; Oct-1-ene-3-ol; Pentylvinylcarbinol; octene-1-ol-3; 1-Okten-3-ol; FEMA No. 2805; n-Oct-1-en-3-ol; NSC 87563; (+/-)-1-octen-3-ol; WXB511GE38; CHEBI:34118; NSC-87563; Amylvinylcarbinol; Morrilol; 1-Okten-3-ol [Czech]; 1-Octen-3-ol (natural); Matsutake alcohol [Japanese]; 1-Octene-3-ol; dl-1-Octen-3-ol; EINECS 222-226-0; EPA Pesticide Chemical Code 069037; BRN 1744110; UNII-WXB511GE38; Morillol; AI3-28627; CCRIS 8804; Matsuika alcohol; MFCD00004589; MOGUCHUN; Vinyl pentyl carbinol; 1 -Octen-3-ol; 1 Octen 3 OL; Nat. 1-Octen-3-ol; (E)-1-octen-3-ol; Flowtron mosquito attractant; DSSTox_CID_15214; DSSTox_RID_79250; DSSTox_GSID_35214; SCHEMBL41968; 1-Octen-3-ol, 98%; WLN: QY5&1U1; CHEMBL3183573; DTXSID3035214; 1-OCTEN-3-OL [FCC]; 1-OCTEN-3-OL [FHFI]; 1-Octen-3-ol, analytical standard; ACT05316; BCP19092; NSC87563; Tox21_302039; LMFA05000090; LMFA05000712; AKOS009157412; CS-W011126; DS-8600; NCGC00255686-01; 1-Octen-3-ol, >=98%, FCC, FG; 1-Octen-3-ol, natural, >=95%, FG; CAS-3391-86-4; DB-003193; FT-0608181; FT-0771699; O0159; 1-Octen-3-ol stabilized with alpha-tocopherol; 4-(Trifluoromethyl)-2-biphenyl-carboxylic acid; D91822; EN300-6981750; A821997; Q161667; Q-100412
|
|
CAS | 3391-86-4 | |
PubChem CID | 18827 | |
ChEMBL ID | CHEMBL3183573 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 128.21 | ALogp: | 2.6 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.446 |
Caco-2 Permeability: | -4.256 | MDCK Permeability: | 0.00003000 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.021 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.062 |
30% Bioavailability (F30%): | 0.796 |
Blood-Brain-Barrier Penetration (BBB): | 0.998 | Plasma Protein Binding (PPB): | 64.23% |
Volume Distribution (VD): | 1.048 | Fu: | 41.17% |
CYP1A2-inhibitor: | 0.403 | CYP1A2-substrate: | 0.887 |
CYP2C19-inhibitor: | 0.112 | CYP2C19-substrate: | 0.808 |
CYP2C9-inhibitor: | 0.05 | CYP2C9-substrate: | 0.887 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.624 |
CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.236 |
Clearance (CL): | 7.65 | Half-life (T1/2): | 0.672 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.024 |
Drug-inuced Liver Injury (DILI): | 0.025 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.567 | Maximum Recommended Daily Dose: | 0.423 |
Skin Sensitization: | 0.558 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.217 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.26 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001211 | 0.545 | D01QLH | 0.314 | ||||
ENC000398 | 0.500 | D06FEA | 0.257 | ||||
ENC000512 | 0.474 | D0I4DQ | 0.257 | ||||
ENC000420 | 0.457 | D0V0IX | 0.253 | ||||
ENC000139 | 0.429 | D0Y3KG | 0.250 | ||||
ENC000554 | 0.378 | D0R3QY | 0.237 | ||||
ENC000459 | 0.378 | D04RGA | 0.202 | ||||
ENC000580 | 0.378 | D08SJZ | 0.200 | ||||
ENC000460 | 0.368 | D0AY9Q | 0.200 | ||||
ENC000315 | 0.364 | D0Z5BC | 0.200 |