|
Name |
3-Ethyl-2-nonanone
|
Molecular Formula | C11H22O | |
IUPAC Name* |
3-ethylnonan-2-one
|
|
SMILES |
CCCCCCC(CC)C(=O)C
|
|
InChI |
InChI=1S/C11H22O/c1-4-6-7-8-9-11(5-2)10(3)12/h11H,4-9H2,1-3H3
|
|
InChIKey |
MDEKWAMTZCERKO-UHFFFAOYSA-N
|
|
Synonyms |
3-Ethyl-2-nonanone; SCHEMBL2495651; AKOS010226771
|
|
CAS | NA | |
PubChem CID | 23288860 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 170.29 | ALogp: | 3.9 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 12 | QED Weighted: | 0.521 |
Caco-2 Permeability: | -4.345 | MDCK Permeability: | 0.00001500 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.919 |
30% Bioavailability (F30%): | 0.963 |
Blood-Brain-Barrier Penetration (BBB): | 0.964 | Plasma Protein Binding (PPB): | 94.98% |
Volume Distribution (VD): | 1.295 | Fu: | 3.45% |
CYP1A2-inhibitor: | 0.821 | CYP1A2-substrate: | 0.927 |
CYP2C19-inhibitor: | 0.46 | CYP2C19-substrate: | 0.776 |
CYP2C9-inhibitor: | 0.395 | CYP2C9-substrate: | 0.896 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.551 |
CYP3A4-inhibitor: | 0.132 | CYP3A4-substrate: | 0.214 |
Clearance (CL): | 11.204 | Half-life (T1/2): | 0.721 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.081 |
Drug-inuced Liver Injury (DILI): | 0.127 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.024 |
Skin Sensitization: | 0.551 | Carcinogencity: | 0.094 |
Eye Corrosion: | 0.987 | Eye Irritation: | 0.985 |
Respiratory Toxicity: | 0.923 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000554 | 0.595 | D0Y3KG | 0.349 | ||||
ENC000797 | 0.550 | D0AY9Q | 0.321 | ||||
ENC000306 | 0.526 | D01QLH | 0.286 | ||||
ENC000833 | 0.525 | D0FD0H | 0.273 | ||||
ENC000570 | 0.523 | D03LGY | 0.269 | ||||
ENC000254 | 0.514 | D0ZK8H | 0.268 | ||||
ENC000454 | 0.513 | D0I4DQ | 0.263 | ||||
ENC000459 | 0.513 | D05ATI | 0.254 | ||||
ENC000519 | 0.512 | D0G2KD | 0.253 | ||||
ENC001126 | 0.512 | D02MLW | 0.253 |