|
Name |
Bicyclohexyl
|
Molecular Formula | C12H22 | |
IUPAC Name* |
cyclohexylcyclohexane
|
|
SMILES |
C1CCC(CC1)C2CCCCC2
|
|
InChI |
InChI=1S/C12H22/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11-12H,1-10H2
|
|
InChIKey |
WVIIMZNLDWSIRH-UHFFFAOYSA-N
|
|
Synonyms |
Bicyclohexyl; 92-51-3; 1,1'-Bicyclohexyl; DICYCLOHEXYL; Cyclohexylcyclohexane; Bicyclohexane; Dicyclohexane; Dodecahydrobiphenyl; Cyclohexane, cyclohexyl-; 1,1'-Biphenyl, dodecahydro-; NSC 59855; MFCD00003815; NSC-59855; Y77501141O; 1,1'-BI(CYCLOHEXYL); 1,1'-Bi(cyclohexane); EINECS 202-161-4; bi(cyclohexane); AI3-01174; 1, dodecahydro-; cyclohexylcyclohexan; UNII-Y77501141O; 1,1-Bicyclohexyl; Bicyclohexyl, 99%; Cyclohexyl Cyclohexane; DSSTox_CID_1802; DSSTox_RID_76336; DSSTox_GSID_21802; CHEMBL1231413; DTXSID8021802; NSC59855; ZINC1689826; Tox21_302104; AKOS005207082; ZINC100508964; CAS-92-51-3; NCGC00255206-01; BS-29633; SY012941; DB-057310; B0902; CS-0081506; FT-0624222; N10369; W-109341; Q21099094; Dicyclohexyl, United States Pharmacopeia (USP) Reference Standard
|
|
CAS | 92-51-3 | |
PubChem CID | 7094 | |
ChEMBL ID | CHEMBL1231413 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 166.3 | ALogp: | 5.7 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 12 | QED Weighted: | 0.528 |
Caco-2 Permeability: | -4.602 | MDCK Permeability: | 0.00001580 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.038 |
30% Bioavailability (F30%): | 0.754 |
Blood-Brain-Barrier Penetration (BBB): | 0.217 | Plasma Protein Binding (PPB): | 97.50% |
Volume Distribution (VD): | 2.915 | Fu: | 1.11% |
CYP1A2-inhibitor: | 0.376 | CYP1A2-substrate: | 0.408 |
CYP2C19-inhibitor: | 0.482 | CYP2C19-substrate: | 0.167 |
CYP2C9-inhibitor: | 0.304 | CYP2C9-substrate: | 0.816 |
CYP2D6-inhibitor: | 0.39 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.293 | CYP3A4-substrate: | 0.148 |
Clearance (CL): | 5.179 | Half-life (T1/2): | 0.07 |
hERG Blockers: | 0.109 | Human Hepatotoxicity (H-HT): | 0.078 |
Drug-inuced Liver Injury (DILI): | 0.788 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.061 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.058 |
Eye Corrosion: | 0.992 | Eye Irritation: | 0.99 |
Respiratory Toxicity: | 0.309 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001169 | 0.658 | D00SBN | 0.412 | ||||
ENC000840 | 0.383 | D04URO | 0.407 | ||||
ENC000323 | 0.375 | D08VSI | 0.368 | ||||
ENC000251 | 0.350 | D0L0MK | 0.338 | ||||
ENC000324 | 0.333 | D07XJM | 0.303 | ||||
ENC004910 | 0.328 | D09GFL | 0.295 | ||||
ENC000893 | 0.316 | D0S5NG | 0.274 | ||||
ENC005710 | 0.313 | D03DVJ | 0.264 | ||||
ENC004377 | 0.284 | D0N4PZ | 0.258 | ||||
ENC003404 | 0.284 | D0R1WR | 0.256 |