![]() |
Name |
chaetoglobosin A
|
Molecular Formula | C32H38N2O5 | |
IUPAC Name* |
6,20-dihydroxy-18-(1H-indol-3-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-19-azatetracyclo[11.8.0.01,16.014,16]henicosa-3,7,11-triene-2,5-dione
|
|
SMILES |
CC1=CC(C)CC=CC2C3OC3(C)C(C)C3C(Cc4c[nH]c5ccccc45)NC(O)C23C(=O)C=CC(=O)C1O
|
|
InChI |
InChI=1S/C32H38N2O5/c1-17-8-7-10-22-29-31(4,39-29)19(3)27-24(15-20-16-33-23-11-6-5-9-21(20)23)34-30(38)32(22,27)26(36)13-12-25(35)28(37)18(2)14-17/h5-7,9-14,16-17,19,22,24,27-30,33-34,37-38H,8,15H2,1-4H3/b10-7+,13-12+,18-14+/t17-,19-,22-,24-,27-,28+,29-,30?,31+,32+/m0/s1
|
|
InChIKey |
FPPLQZPYAUIPGI-UECQRVHPSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 530.67 | ALogp: | 3.6 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 114.9 | Aromatic Rings: | 6 |
Heavy Atoms: | 39 | QED Weighted: | 0.339 |
Caco-2 Permeability: | -4.986 | MDCK Permeability: | 0.00001690 |
Pgp-inhibitor: | 0.981 | Pgp-substrate: | 0.265 |
Human Intestinal Absorption (HIA): | 0.049 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.023 |
Blood-Brain-Barrier Penetration (BBB): | 0.961 | Plasma Protein Binding (PPB): | 92.51% |
Volume Distribution (VD): | 1.305 | Fu: | 5.46% |
CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.459 |
CYP2C19-inhibitor: | 0.432 | CYP2C19-substrate: | 0.384 |
CYP2C9-inhibitor: | 0.194 | CYP2C9-substrate: | 0.142 |
CYP2D6-inhibitor: | 0.63 | CYP2D6-substrate: | 0.85 |
CYP3A4-inhibitor: | 0.927 | CYP3A4-substrate: | 0.583 |
Clearance (CL): | 8.698 | Half-life (T1/2): | 0.09 |
hERG Blockers: | 0.177 | Human Hepatotoxicity (H-HT): | 0.481 |
Drug-inuced Liver Injury (DILI): | 0.128 | AMES Toxicity: | 0.124 |
Rat Oral Acute Toxicity: | 0.481 | Maximum Recommended Daily Dose: | 0.923 |
Skin Sensitization: | 0.051 | Carcinogencity: | 0.109 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.959 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004473 | ![]() |
0.787 | D01TSI | ![]() |
0.254 | ||
ENC002120 | ![]() |
0.698 | D0SP3D | ![]() |
0.247 | ||
ENC002440 | ![]() |
0.656 | D0V3ZA | ![]() |
0.247 | ||
ENC003586 | ![]() |
0.652 | D02DMQ | ![]() |
0.247 | ||
ENC003226 | ![]() |
0.632 | D09NNH | ![]() |
0.241 | ||
ENC004470 | ![]() |
0.603 | D0W7WC | ![]() |
0.238 | ||
ENC002646 | ![]() |
0.574 | D0BV3J | ![]() |
0.238 | ||
ENC002953 | ![]() |
0.572 | D05EJG | ![]() |
0.238 | ||
ENC004465 | ![]() |
0.568 | D00YLW | ![]() |
0.218 | ||
ENC002679 | ![]() |
0.558 | D0R5OS | ![]() |
0.217 |