![]() |
Name |
Cytoglobosin D
|
Molecular Formula | C32H38N2O4 | |
IUPAC Name* |
(1S,3E,5S,6R,7E,9S,11E,13S,16S,17R,18S)-5,6-dihydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11,14-tetraene-2,20-dione
|
|
SMILES |
C[C@H]\1C/C=C/[C@H]2C=C([C@H]([C@@H]3[C@@]2(C(=O)/C=C/[C@@H]([C@@H](/C(=C1)/C)O)O)C(=O)N[C@H]3CC4=CNC5=CC=CC=C54)C)C
|
|
InChI |
InChI=1S/C32H38N2O4/c1-18-8-7-9-23-15-19(2)21(4)29-26(16-22-17-33-25-11-6-5-10-24(22)25)34-31(38)32(23,29)28(36)13-12-27(35)30(37)20(3)14-18/h5-7,9-15,17-18,21,23,26-27,29-30,33,35,37H,8,16H2,1-4H3,(H,34,38)/b9-7+,13-12+,20-14+/t18-,21+,23-,26-,27-,29-,30+,32+/m0/s1
|
|
InChIKey |
PSEVHIVYAHBJDR-HMIIDTQCSA-N
|
|
Synonyms |
Cytoglobosin D; CHEMBL1098275; HY-N10202; CS-0372632
|
|
CAS | NA | |
PubChem CID | 46209919 | |
ChEMBL ID | CHEMBL1098275 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 514.7 | ALogp: | 3.8 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 102.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 38 | QED Weighted: | 0.337 |
Caco-2 Permeability: | -4.878 | MDCK Permeability: | 0.00001870 |
Pgp-inhibitor: | 0.962 | Pgp-substrate: | 0.981 |
Human Intestinal Absorption (HIA): | 0.044 | 20% Bioavailability (F20%): | 0.059 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.906 | Plasma Protein Binding (PPB): | 99.14% |
Volume Distribution (VD): | 0.387 | Fu: | 1.89% |
CYP1A2-inhibitor: | 0.292 | CYP1A2-substrate: | 0.459 |
CYP2C19-inhibitor: | 0.949 | CYP2C19-substrate: | 0.643 |
CYP2C9-inhibitor: | 0.868 | CYP2C9-substrate: | 0.602 |
CYP2D6-inhibitor: | 0.473 | CYP2D6-substrate: | 0.695 |
CYP3A4-inhibitor: | 0.972 | CYP3A4-substrate: | 0.306 |
Clearance (CL): | 8.393 | Half-life (T1/2): | 0.139 |
hERG Blockers: | 0.125 | Human Hepatotoxicity (H-HT): | 0.119 |
Drug-inuced Liver Injury (DILI): | 0.229 | AMES Toxicity: | 0.344 |
Rat Oral Acute Toxicity: | 0.891 | Maximum Recommended Daily Dose: | 0.942 |
Skin Sensitization: | 0.505 | Carcinogencity: | 0.559 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.983 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002151 | ![]() |
0.826 | D02DMQ | ![]() |
0.252 | ||
ENC005215 | ![]() |
0.797 | D0W7WC | ![]() |
0.252 | ||
ENC002953 | ![]() |
0.783 | D01TSI | ![]() |
0.245 | ||
ENC002955 | ![]() |
0.740 | D05EJG | ![]() |
0.244 | ||
ENC003245 | ![]() |
0.724 | D0BV3J | ![]() |
0.242 | ||
ENC002440 | ![]() |
0.685 | D0SP3D | ![]() |
0.238 | ||
ENC003856 | ![]() |
0.667 | D09NNH | ![]() |
0.238 | ||
ENC002120 | ![]() |
0.649 | D0V3ZA | ![]() |
0.238 | ||
ENC003226 | ![]() |
0.634 | D02XIY | ![]() |
0.225 | ||
ENC002682 | ![]() |
0.634 | D00YLW | ![]() |
0.222 |