![]() |
Name |
chaetoglobosin R
|
Molecular Formula | C32H38N2O6 | |
IUPAC Name* |
(1R,3E,6R,7E,9S,11E,13R,14S,15S,16S,17R,18S)-6,14,15-trihydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11-triene-2,5,20-trione
|
|
SMILES |
C[C@H]\1C/C=C/[C@H]2[C@@H]([C@@]([C@H]([C@@H]3[C@@]2(C(=O)/C=C/C(=O)[C@@H](/C(=C1)/C)O)C(=O)N[C@H]3CC4=CNC5=CC=CC=C54)C)(C)O)O
|
|
InChI |
InChI=1S/C32H38N2O6/c1-17-8-7-10-22-29(38)31(4,40)19(3)27-24(15-20-16-33-23-11-6-5-9-21(20)23)34-30(39)32(22,27)26(36)13-12-25(35)28(37)18(2)14-17/h5-7,9-14,16-17,19,22,24,27-29,33,37-38,40H,8,15H2,1-4H3,(H,34,39)/b10-7+,13-12+,18-14+/t17-,19-,22-,24-,27-,28+,29-,31-,32+/m0/s1
|
|
InChIKey |
GXXPQGPTEVHUTJ-NOQRJRBPSA-N
|
|
Synonyms |
chaetoglobosin R; CHEBI:68737; Q27137156; (1R,3E,6R,7E,9S,11E,13R,14S,15S,16S,17R,18S)-6,14,15-trihydroxy-18-(1H-indol-3-ylmethyl)-7,9,15,16-tetramethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11-triene-2,5,20-trione; (3S,3aR,4S,5S,6S,6aR,7E,10S,11E,13R,15E,17aR)-5,6,13-trihydroxy-3-(1H-indol-3-ylmethyl)-4,5,10,12-tetramethyl-2,3,3a,4,5,6,6a,9,10,13-decahydro-1H-cyclotrideca[d]isoindole-1,14,17-trione
|
|
CAS | NA | |
PubChem CID | 11192029 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 546.7 | ALogp: | 2.7 |
HBD: | 5 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 140.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 40 | QED Weighted: | 0.288 |
Caco-2 Permeability: | -5.007 | MDCK Permeability: | 0.00001260 |
Pgp-inhibitor: | 0.97 | Pgp-substrate: | 0.937 |
Human Intestinal Absorption (HIA): | 0.171 | 20% Bioavailability (F20%): | 0.097 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.287 | Plasma Protein Binding (PPB): | 94.87% |
Volume Distribution (VD): | 0.271 | Fu: | 3.12% |
CYP1A2-inhibitor: | 0.03 | CYP1A2-substrate: | 0.218 |
CYP2C19-inhibitor: | 0.164 | CYP2C19-substrate: | 0.422 |
CYP2C9-inhibitor: | 0.205 | CYP2C9-substrate: | 0.43 |
CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.114 |
CYP3A4-inhibitor: | 0.892 | CYP3A4-substrate: | 0.259 |
Clearance (CL): | 4.978 | Half-life (T1/2): | 0.634 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.456 |
Drug-inuced Liver Injury (DILI): | 0.223 | AMES Toxicity: | 0.041 |
Rat Oral Acute Toxicity: | 0.712 | Maximum Recommended Daily Dose: | 0.932 |
Skin Sensitization: | 0.156 | Carcinogencity: | 0.107 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.936 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004473 | ![]() |
0.840 | D01TSI | ![]() |
0.266 | ||
ENC002440 | ![]() |
0.802 | D0V3ZA | ![]() |
0.259 | ||
ENC003226 | ![]() |
0.744 | D0SP3D | ![]() |
0.259 | ||
ENC006149 | ![]() |
0.698 | D09NNH | ![]() |
0.253 | ||
ENC002953 | ![]() |
0.677 | D0W7WC | ![]() |
0.245 | ||
ENC003586 | ![]() |
0.672 | D02DMQ | ![]() |
0.245 | ||
ENC002679 | ![]() |
0.649 | D0BV3J | ![]() |
0.244 | ||
ENC002681 | ![]() |
0.639 | D05EJG | ![]() |
0.236 | ||
ENC002955 | ![]() |
0.639 | D02XIY | ![]() |
0.231 | ||
ENC004470 | ![]() |
0.622 | D0R5OS | ![]() |
0.223 |