![]() |
Name |
asperlention G
|
Molecular Formula | C34H32O15 | |
IUPAC Name* |
methyl4-acetyloxy-5-(1,5,8-trihydroxy-10a-methoxycarbonyl-3-methyl-9-oxo-6,7-dihydro-5H-xanthen-2-yl)-1,8-dihydroxy-3-methyl-9-oxo-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
COC(=O)C12Oc3cc(C)c(-c4ccc(O)c5c4OC4(C(=O)OC)C(=C(O)CC(C)C4OC(C)=O)C5=O)c(O)c3C(=O)C1=C(O)CCC2O
|
|
InChI |
InChI=1S/C34H32O15/c1-12-11-19-23(28(42)24-17(37)8-9-20(39)33(24,48-19)31(43)45-4)26(40)21(12)15-6-7-16(36)22-27(41)25-18(38)10-13(2)30(47-14(3)35)34(25,32(44)46-5)49-29(15)22/h6-7,11,13,20,30,36-40H,8-10H2,1-5H3/t13-,20-,30-,33?,34+/m0/s1
|
|
InChIKey |
YUNGLUVSQVBKQB-MSNJPTENSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 680.62 | ALogp: | 2.8 |
HBD: | 5 | HBA: | 15 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 232.6 | Aromatic Rings: | 6 |
Heavy Atoms: | 49 | QED Weighted: | 0.229 |
Caco-2 Permeability: | -5.462 | MDCK Permeability: | 0.00001170 |
Pgp-inhibitor: | 0.829 | Pgp-substrate: | 0.989 |
Human Intestinal Absorption (HIA): | 0.783 | 20% Bioavailability (F20%): | 0.138 |
30% Bioavailability (F30%): | 0.853 |
Blood-Brain-Barrier Penetration (BBB): | 0.008 | Plasma Protein Binding (PPB): | 89.54% |
Volume Distribution (VD): | 0.64 | Fu: | 4.45% |
CYP1A2-inhibitor: | 0.013 | CYP1A2-substrate: | 0.565 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.1 |
CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.168 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.139 |
CYP3A4-inhibitor: | 0.678 | CYP3A4-substrate: | 0.444 |
Clearance (CL): | 2.302 | Half-life (T1/2): | 0.013 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.914 |
Drug-inuced Liver Injury (DILI): | 0.954 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.993 | Maximum Recommended Daily Dose: | 0.782 |
Skin Sensitization: | 0.016 | Carcinogencity: | 0.025 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.033 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006117 | ![]() |
0.867 | D01XWG | ![]() |
0.291 | ||
ENC006113 | ![]() |
0.732 | D0T5XN | ![]() |
0.282 | ||
ENC006114 | ![]() |
0.696 | D07IPB | ![]() |
0.280 | ||
ENC006115 | ![]() |
0.671 | D07VLY | ![]() |
0.280 | ||
ENC005073 | ![]() |
0.520 | D0C9XJ | ![]() |
0.280 | ||
ENC003816 | ![]() |
0.506 | D0FX2Q | ![]() |
0.274 | ||
ENC005074 | ![]() |
0.500 | D01UBX | ![]() |
0.271 | ||
ENC005730 | ![]() |
0.500 | D0Q0PR | ![]() |
0.268 | ||
ENC005885 | ![]() |
0.477 | D01XDL | ![]() |
0.264 | ||
ENC005075 | ![]() |
0.471 | D0T8EH | ![]() |
0.260 |