![]() |
Name |
asperlention H
|
Molecular Formula | C35H34O15 | |
IUPAC Name* |
methyl4-acetyloxy-1,8-dihydroxy-3-methyl-9-oxo-5-[1,5,8-trihydroxy-10a-(2-methoxy-2-oxoethyl)-3-methyl-9-oxo-6,7-dihydro-5H-xanthen-2-yl]-3,4-dihydro-2H-xanthene-4a-carboxylate
|
|
SMILES |
COC(=O)CC12Oc3cc(C)c(-c4ccc(O)c5c4OC4(C(=O)OC)C(=C(O)CC(C)C4OC(C)=O)C5=O)c(O)c3C(=O)C1=C(O)CCC2O
|
|
InChI |
InChI=1S/C35H34O15/c1-13-11-20-25(30(44)26-18(38)8-9-21(40)34(26,49-20)12-22(41)46-4)28(42)23(13)16-6-7-17(37)24-29(43)27-19(39)10-14(2)32(48-15(3)36)35(27,33(45)47-5)50-31(16)24/h6-7,11,14,21,32,37-40,42H,8-10,12H2,1-5H3/t14-,21-,32-,34?,35+/m0/s1
|
|
InChIKey |
KZZFLBSTIHXGCU-OQAHDHDOSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 694.64 | ALogp: | 3.2 |
HBD: | 5 | HBA: | 15 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 232.6 | Aromatic Rings: | 6 |
Heavy Atoms: | 50 | QED Weighted: | 0.22 |
Caco-2 Permeability: | -5.477 | MDCK Permeability: | 0.00001120 |
Pgp-inhibitor: | 0.81 | Pgp-substrate: | 0.992 |
Human Intestinal Absorption (HIA): | 0.829 | 20% Bioavailability (F20%): | 0.09 |
30% Bioavailability (F30%): | 0.901 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 86.22% |
Volume Distribution (VD): | 0.543 | Fu: | 6.06% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.291 |
CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.074 |
CYP2C9-inhibitor: | 0.031 | CYP2C9-substrate: | 0.19 |
CYP2D6-inhibitor: | 0.026 | CYP2D6-substrate: | 0.126 |
CYP3A4-inhibitor: | 0.716 | CYP3A4-substrate: | 0.324 |
Clearance (CL): | 4.17 | Half-life (T1/2): | 0.028 |
hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.91 |
Drug-inuced Liver Injury (DILI): | 0.951 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.994 | Maximum Recommended Daily Dose: | 0.74 |
Skin Sensitization: | 0.015 | Carcinogencity: | 0.016 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.051 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006116 | ![]() |
0.867 | D07IPB | ![]() |
0.288 | ||
ENC006114 | ![]() |
0.737 | D01XWG | ![]() |
0.286 | ||
ENC006113 | ![]() |
0.696 | D0T5XN | ![]() |
0.284 | ||
ENC006115 | ![]() |
0.669 | D0C9XJ | ![]() |
0.282 | ||
ENC005073 | ![]() |
0.538 | D07VLY | ![]() |
0.282 | ||
ENC005074 | ![]() |
0.517 | D01UBX | ![]() |
0.273 | ||
ENC005730 | ![]() |
0.492 | D0FX2Q | ![]() |
0.270 | ||
ENC005075 | ![]() |
0.487 | D0Q0PR | ![]() |
0.270 | ||
ENC004764 | ![]() |
0.471 | D0T8EH | ![]() |
0.262 | ||
ENC005070 | ![]() |
0.469 | D01XDL | ![]() |
0.259 |