|
Name |
Xenoacremone G
|
Molecular Formula | C29H33NO4 | |
IUPAC Name* |
13-ethenyl-19-hydroxy-5,7-dimethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(23),11,16(26),21,24-pentaene-15,17-dione
|
|
SMILES |
C=CC1C=CC2C3CC(C)CC(C)C3C3Oc4ccc(cc4)CC4(O)C=C(C(=O)N4)C(=O)C1C23
|
|
InChI |
InChI=1S/C29H33NO4/c1-4-18-7-10-20-21-12-15(2)11-16(3)23(21)27-25(20)24(18)26(31)22-14-29(33,30-28(22)32)13-17-5-8-19(34-27)9-6-17/h4-10,14-16,18,20-21,23-25,27,33H,1,11-13H2,2-3H3,(H,30,32)/t15-,16+,18-,20-,21+,23-,24-,25+,27-,29-/m1/s1
|
|
InChIKey |
QRNDDJJVIFLUFC-JWXOWHJWSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 459.59 | ALogp: | 3.8 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 7 |
Heavy Atoms: | 34 | QED Weighted: | 0.479 |
Caco-2 Permeability: | -4.706 | MDCK Permeability: | 0.00017162 |
Pgp-inhibitor: | 0.904 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.088 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.017 |
Blood-Brain-Barrier Penetration (BBB): | 0.654 | Plasma Protein Binding (PPB): | 99.58% |
Volume Distribution (VD): | 1.979 | Fu: | 1.30% |
CYP1A2-inhibitor: | 0.15 | CYP1A2-substrate: | 0.826 |
CYP2C19-inhibitor: | 0.865 | CYP2C19-substrate: | 0.853 |
CYP2C9-inhibitor: | 0.801 | CYP2C9-substrate: | 0.1 |
CYP2D6-inhibitor: | 0.12 | CYP2D6-substrate: | 0.254 |
CYP3A4-inhibitor: | 0.968 | CYP3A4-substrate: | 0.858 |
Clearance (CL): | 3.296 | Half-life (T1/2): | 0.039 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.033 |
Drug-inuced Liver Injury (DILI): | 0.892 | AMES Toxicity: | 0.129 |
Rat Oral Acute Toxicity: | 0.93 | Maximum Recommended Daily Dose: | 0.953 |
Skin Sensitization: | 0.025 | Carcinogencity: | 0.08 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.92 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005770 | 0.730 | D0VA0I | 0.244 | ||||
ENC005135 | 0.711 | D01XDL | 0.198 | ||||
ENC003137 | 0.647 | D06WTZ | 0.197 | ||||
ENC005766 | 0.598 | D0V3ZA | 0.197 | ||||
ENC005768 | 0.579 | D0H0ND | 0.195 | ||||
ENC005767 | 0.492 | D09NNH | 0.191 | ||||
ENC003349 | 0.485 | D09NIA | 0.191 | ||||
ENC003606 | 0.479 | D02FEM | 0.189 | ||||
ENC005366 | 0.479 | D01JGV | 0.188 | ||||
ENC005320 | 0.453 | D0U7GP | 0.188 |