|
Name |
(1S,3R,4R,7S,10S,11R,13S,15R,16S,17S,25S,31R)-24-hydroxy-4,6,7,9,13,15-hexamethyl-18,26-dioxa-28-azaoctacyclo[22.2.2.219,22.13,10.01,25.04,8.011,16.017,31]hentriaconta-5,8,19(30),20,22(29)-pentaene-2,27-dione
|
Molecular Formula | C34H41NO5 | |
IUPAC Name* |
(1S,3R,4R,7S,10S,11R,13S,15R,16S,17S,25S,31R)-24-hydroxy-4,6,7,9,13,15-hexamethyl-18,26-dioxa-28-azaoctacyclo[22.2.2.219,22.13,10.01,25.04,8.011,16.017,31]hentriaconta-5,8,19(30),20,22(29)-pentaene-2,27-dione
|
|
SMILES |
C[C@H]1C[C@H]([C@H]2[C@H](C1)[C@H]3[C@H]4[C@H]2OC5=CC=C(CC6([C@@H]7[C@](O7)(C(=O)[C@H]4[C@]8(C=C([C@@H](C8=C3C)C)C)C)C(=O)N6)O)C=C5)C
|
|
InChI |
InChI=1S/C34H41NO5/c1-15-11-16(2)23-22(12-15)24-19(5)26-18(4)17(3)13-32(26,6)27-25(24)28(23)39-21-9-7-20(8-10-21)14-33(38)30-34(40-30,29(27)36)31(37)35-33/h7-10,13,15-16,18,22-25,27-28,30,38H,11-12,14H2,1-6H3,(H,35,37)/t15-,16+,18-,22-,23-,24-,25+,27-,28-,30+,32-,33?,34+/m0/s1
|
|
InChIKey |
NQFJAFJMOUIAAX-UGRKIXEPSA-N
|
|
Synonyms |
Phomapyrrolidone C
|
|
CAS | NA | |
PubChem CID | 139583975 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 543.7 | ALogp: | 4.7 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 88.2 | Aromatic Rings: | 9 |
Heavy Atoms: | 40 | QED Weighted: | 0.271 |
Caco-2 Permeability: | -5.181 | MDCK Permeability: | 0.00005310 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.998 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.047 |
30% Bioavailability (F30%): | 0.669 |
Blood-Brain-Barrier Penetration (BBB): | 0.5 | Plasma Protein Binding (PPB): | 98.32% |
Volume Distribution (VD): | 2.245 | Fu: | 3.18% |
CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.902 |
CYP2C19-inhibitor: | 0.747 | CYP2C19-substrate: | 0.869 |
CYP2C9-inhibitor: | 0.383 | CYP2C9-substrate: | 0.013 |
CYP2D6-inhibitor: | 0.028 | CYP2D6-substrate: | 0.065 |
CYP3A4-inhibitor: | 0.965 | CYP3A4-substrate: | 0.801 |
Clearance (CL): | 13.469 | Half-life (T1/2): | 0.033 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.549 |
Drug-inuced Liver Injury (DILI): | 0.966 | AMES Toxicity: | 0.306 |
Rat Oral Acute Toxicity: | 0.877 | Maximum Recommended Daily Dose: | 0.967 |
Skin Sensitization: | 0.364 | Carcinogencity: | 0.651 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.984 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D0TG7I | 0.221 | ||||||
D0W2EK | 0.220 | ||||||
D0I5DS | 0.211 | ||||||
D03LJR | 0.210 | ||||||
D07DIM | 0.208 | ||||||
D09HNR | 0.206 | ||||||
D0E9KA | 0.206 | ||||||
D01UBX | 0.205 | ||||||
D0K3QS | 0.202 | ||||||
D0VA0I | 0.202 |