|
Name |
xenoacremone H
|
Molecular Formula | C29H35NO4 | |
IUPAC Name* |
13-ethenyl-19-hydroxy-5,7-dimethyl-18-oxa-20-azahexacyclo[17.2.2.13,10.117,19.04,9.014,36]pentacosa-1(21),11,17(24),22-tetraene-15,21-dione
|
|
SMILES |
C=CC1C=CC2C3CC(C)CC(C)C3C3Oc4ccc(cc4)CC4(O)CC(C(=O)N4)C(=O)C1C23
|
|
InChI |
InChI=1S/C29H35NO4/c1-4-18-7-10-20-21-12-15(2)11-16(3)23(21)27-25(20)24(18)26(31)22-14-29(33,30-28(22)32)13-17-5-8-19(34-27)9-6-17/h4-10,15-16,18,20-25,27,33H,1,11-14H2,2-3H3,(H,30,32)/t15-,16+,18-,20+,21+,22+,23-,24+,25+,27-,29-/m1/s1
|
|
InChIKey |
NZJRFVHZFAKZDF-WIDCEILXSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 461.6 | ALogp: | 3.9 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 7 |
Heavy Atoms: | 34 | QED Weighted: | 0.475 |
Caco-2 Permeability: | -4.656 | MDCK Permeability: | 0.00024900 |
Pgp-inhibitor: | 0.054 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.101 | 20% Bioavailability (F20%): | 0.05 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.441 | Plasma Protein Binding (PPB): | 97.93% |
Volume Distribution (VD): | 1.379 | Fu: | 2.98% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.897 |
CYP2C19-inhibitor: | 0.786 | CYP2C19-substrate: | 0.887 |
CYP2C9-inhibitor: | 0.371 | CYP2C9-substrate: | 0.098 |
CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.394 |
CYP3A4-inhibitor: | 0.924 | CYP3A4-substrate: | 0.843 |
Clearance (CL): | 9.345 | Half-life (T1/2): | 0.046 |
hERG Blockers: | 0.059 | Human Hepatotoxicity (H-HT): | 0.048 |
Drug-inuced Liver Injury (DILI): | 0.934 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.989 | Maximum Recommended Daily Dose: | 0.956 |
Skin Sensitization: | 0.034 | Carcinogencity: | 0.039 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.924 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005769 | 0.730 | D0VA0I | 0.236 | ||||
ENC005135 | 0.726 | D02FEM | 0.202 | ||||
ENC005766 | 0.667 | D01XDL | 0.198 | ||||
ENC003349 | 0.647 | D06WTZ | 0.197 | ||||
ENC005768 | 0.579 | D0H0ND | 0.195 | ||||
ENC004853 | 0.547 | D0V4WD | 0.194 | ||||
ENC005320 | 0.543 | D0V3ZA | 0.190 | ||||
ENC004852 | 0.504 | D0I5DS | 0.190 | ||||
ENC005767 | 0.492 | D0U7GP | 0.188 | ||||
ENC003137 | 0.485 | D03IKT | 0.188 |