![]() |
Name |
peperophthalene
|
Molecular Formula | C13H14O3 | |
IUPAC Name* |
4,8-dimethoxy-6-methylnaphthalen-2-ol
|
|
SMILES |
COc1cc(O)cc2c(OC)cc(C)cc12
|
|
InChI |
InChI=1S/C13H14O3/c1-8-4-10-11(12(5-8)15-2)6-9(14)7-13(10)16-3/h4-7,14H,1-3H3
|
|
InChIKey |
WNGCAYZFLQFNHC-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 218.25 | ALogp: | 2.9 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.835 |
Caco-2 Permeability: | -4.689 | MDCK Permeability: | 0.00002090 |
Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.964 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.705 |
30% Bioavailability (F30%): | 0.127 |
Blood-Brain-Barrier Penetration (BBB): | 0.13 | Plasma Protein Binding (PPB): | 92.56% |
Volume Distribution (VD): | 0.684 | Fu: | 6.24% |
CYP1A2-inhibitor: | 0.981 | CYP1A2-substrate: | 0.949 |
CYP2C19-inhibitor: | 0.469 | CYP2C19-substrate: | 0.833 |
CYP2C9-inhibitor: | 0.144 | CYP2C9-substrate: | 0.91 |
CYP2D6-inhibitor: | 0.731 | CYP2D6-substrate: | 0.932 |
CYP3A4-inhibitor: | 0.371 | CYP3A4-substrate: | 0.291 |
Clearance (CL): | 12.511 | Half-life (T1/2): | 0.757 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.14 |
Drug-inuced Liver Injury (DILI): | 0.842 | AMES Toxicity: | 0.355 |
Rat Oral Acute Toxicity: | 0.099 | Maximum Recommended Daily Dose: | 0.902 |
Skin Sensitization: | 0.915 | Carcinogencity: | 0.102 |
Eye Corrosion: | 0.192 | Eye Irritation: | 0.981 |
Respiratory Toxicity: | 0.802 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005123 | ![]() |
0.508 | D06GCK | ![]() |
0.329 | ||
ENC006012 | ![]() |
0.500 | D0AO5H | ![]() |
0.308 | ||
ENC002683 | ![]() |
0.500 | D0NJ3V | ![]() |
0.307 | ||
ENC002468 | ![]() |
0.480 | D01SAT | ![]() |
0.307 | ||
ENC005978 | ![]() |
0.480 | D06QKV | ![]() |
0.303 | ||
ENC006015 | ![]() |
0.462 | D0Q9ON | ![]() |
0.298 | ||
ENC002381 | ![]() |
0.462 | D09GYT | ![]() |
0.292 | ||
ENC000501 | ![]() |
0.451 | D07MGA | ![]() |
0.280 | ||
ENC001490 | ![]() |
0.442 | D0Y7TS | ![]() |
0.280 | ||
ENC006013 | ![]() |
0.437 | D0D4HN | ![]() |
0.277 |