![]() |
Name |
Monomethylsulochrin
|
Molecular Formula | C18H18O7 | |
IUPAC Name* |
methyl 5-hydroxy-2-(2-hydroxy-6-methoxy-4-methylbenzoyl)-3-methoxybenzoate
|
|
SMILES |
CC1=CC(=C(C(=C1)OC)C(=O)C2=C(C=C(C=C2OC)O)C(=O)OC)O
|
|
InChI |
InChI=1S/C18H18O7/c1-9-5-12(20)16(13(6-9)23-2)17(21)15-11(18(22)25-4)7-10(19)8-14(15)24-3/h5-8,19-20H,1-4H3
|
|
InChIKey |
XJOBKBUGVMLSEJ-UHFFFAOYSA-N
|
|
Synonyms |
Monomethylsulochrin; 10056-14-1; methyl 5-hydroxy-2-(2-hydroxy-6-methoxy-4-methylbenzoyl)-3-methoxybenzoate; 5-hydroxy-2-(2-hydroxy-6-methoxy-4-methylbenzoyl)-3-methoxy-benzoic acid, methyl ester; MLS004256137; CHEMBL61100; MEGxm0_000131; ACon0_000927; ACon1_000924; ZINC14761002; NCGC00169225-01; SMR003081022; BRD-K01160025-001-01-5; 5-hydroxy-2-(2-hydroxy-6-methoxy-4-methylbenzoyl)-3-methoxybenzoic acid methyl ester; NCGC00169225-02!methyl 5-hydroxy-2-(2-hydroxy-6-methoxy-4-methylbenzoyl)-3-methoxybenzoate
|
|
CAS | NA | |
PubChem CID | 23872041 | |
ChEMBL ID | CHEMBL61100 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 346.3 | ALogp: | 3.3 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 25 | QED Weighted: | 0.633 |
Caco-2 Permeability: | -4.879 | MDCK Permeability: | 0.00001530 |
Pgp-inhibitor: | 0.015 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.12 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.301 |
Blood-Brain-Barrier Penetration (BBB): | 0.105 | Plasma Protein Binding (PPB): | 92.26% |
Volume Distribution (VD): | 0.603 | Fu: | 7.65% |
CYP1A2-inhibitor: | 0.946 | CYP1A2-substrate: | 0.94 |
CYP2C19-inhibitor: | 0.565 | CYP2C19-substrate: | 0.126 |
CYP2C9-inhibitor: | 0.654 | CYP2C9-substrate: | 0.875 |
CYP2D6-inhibitor: | 0.538 | CYP2D6-substrate: | 0.746 |
CYP3A4-inhibitor: | 0.791 | CYP3A4-substrate: | 0.241 |
Clearance (CL): | 13.078 | Half-life (T1/2): | 0.683 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.072 |
Drug-inuced Liver Injury (DILI): | 0.925 | AMES Toxicity: | 0.513 |
Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.777 |
Skin Sensitization: | 0.07 | Carcinogencity: | 0.02 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.886 |
Respiratory Toxicity: | 0.217 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005978 | ![]() |
1.000 | D06GCK | ![]() |
0.360 | ||
ENC006012 | ![]() |
0.819 | D00WVW | ![]() |
0.302 | ||
ENC002683 | ![]() |
0.819 | D09DHY | ![]() |
0.301 | ||
ENC000936 | ![]() |
0.795 | D07MGA | ![]() |
0.293 | ||
ENC004806 | ![]() |
0.763 | D0NJ3V | ![]() |
0.290 | ||
ENC005979 | ![]() |
0.763 | D0E6OC | ![]() |
0.288 | ||
ENC005977 | ![]() |
0.738 | D0C1SF | ![]() |
0.282 | ||
ENC001522 | ![]() |
0.713 | D0Y7TS | ![]() |
0.279 | ||
ENC001490 | ![]() |
0.696 | D02LZB | ![]() |
0.279 | ||
ENC006015 | ![]() |
0.691 | D0D4HN | ![]() |
0.277 |