![]() |
Name |
(3S*,6R*,7R*)-3,4,5,6,7,8-hexahydro-7-hydroxy-7-methyl-8-oxo-3-[(E)-prop-1-enyl]-1H-isochromen-6-yl 2,4-dihydroxy-6-methylbenzoate
|
Molecular Formula | C21H24O7 | |
IUPAC Name* |
(7-hydroxy-7-methyl-8-oxo-3-prop-1-enyl-3,4,5,6-tetrahydro-1H-isochromen-6-yl)2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
CC=CC1CC2=C(CO1)C(=O)C(C)(O)C(OC(=O)c1c(C)cc(O)cc1O)C2
|
|
InChI |
InChI=1S/C21H24O7/c1-4-5-14-7-12-8-17(21(3,26)19(24)15(12)10-27-14)28-20(25)18-11(2)6-13(22)9-16(18)23/h4-6,9,14,17,22-23,26H,7-8,10H2,1-3H3/b5-4+/t14-,17-,21-/m1/s1
|
|
InChIKey |
WYBLHHQOVMAUNE-FSWYFZHTSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 388.42 | ALogp: | 2.3 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.3 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.539 |
Caco-2 Permeability: | -4.712 | MDCK Permeability: | 0.00001190 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.223 |
Human Intestinal Absorption (HIA): | 0.041 | 20% Bioavailability (F20%): | 0.906 |
30% Bioavailability (F30%): | 0.837 |
Blood-Brain-Barrier Penetration (BBB): | 0.558 | Plasma Protein Binding (PPB): | 92.55% |
Volume Distribution (VD): | 1.169 | Fu: | 7.55% |
CYP1A2-inhibitor: | 0.292 | CYP1A2-substrate: | 0.498 |
CYP2C19-inhibitor: | 0.133 | CYP2C19-substrate: | 0.101 |
CYP2C9-inhibitor: | 0.181 | CYP2C9-substrate: | 0.723 |
CYP2D6-inhibitor: | 0.415 | CYP2D6-substrate: | 0.14 |
CYP3A4-inhibitor: | 0.773 | CYP3A4-substrate: | 0.237 |
Clearance (CL): | 8.647 | Half-life (T1/2): | 0.678 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.049 |
Drug-inuced Liver Injury (DILI): | 0.938 | AMES Toxicity: | 0.129 |
Rat Oral Acute Toxicity: | 0.537 | Maximum Recommended Daily Dose: | 0.349 |
Skin Sensitization: | 0.04 | Carcinogencity: | 0.77 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.149 |
Respiratory Toxicity: | 0.817 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002726 | ![]() |
0.652 | D07MGA | ![]() |
0.257 | ||
ENC003691 | ![]() |
0.646 | D08NQZ | ![]() |
0.240 | ||
ENC003451 | ![]() |
0.602 | D0R6RC | ![]() |
0.237 | ||
ENC003450 | ![]() |
0.602 | D08LTU | ![]() |
0.235 | ||
ENC003838 | ![]() |
0.590 | D0J2NK | ![]() |
0.227 | ||
ENC003839 | ![]() |
0.590 | D02GAC | ![]() |
0.226 | ||
ENC003449 | ![]() |
0.590 | D05AFR | ![]() |
0.226 | ||
ENC002211 | ![]() |
0.582 | D0H0SJ | ![]() |
0.213 | ||
ENC003837 | ![]() |
0.570 | D0R9WP | ![]() |
0.212 | ||
ENC002132 | ![]() |
0.552 | D0S0LZ | ![]() |
0.212 |