|
Name |
3-[(3R,6R,7R)-6-(2,4-dihydroxy-6-methylbenzoyl)oxy-3,7-dihydroxy-7-methyl-8-oxo-1,4,5,6-tetrahydroisochromen-3-yl]propanoic acid
|
Molecular Formula | C21H24O10 | |
IUPAC Name* |
3-[(3R,6R,7R)-6-(2,4-dihydroxy-6-methylbenzoyl)oxy-3,7-dihydroxy-7-methyl-8-oxo-1,4,5,6-tetrahydroisochromen-3-yl]propanoic acid
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)O[C@@H]2CC3=C(CO[C@@](C3)(CCC(=O)O)O)C(=O)[C@]2(C)O)O)O
|
|
InChI |
InChI=1S/C21H24O10/c1-10-5-12(22)7-14(23)17(10)19(27)31-15-6-11-8-21(29,4-3-16(24)25)30-9-13(11)18(26)20(15,2)28/h5,7,15,22-23,28-29H,3-4,6,8-9H2,1-2H3,(H,24,25)/t15-,20-,21-/m1/s1
|
|
InChIKey |
UGUYPVZDRVCYAD-IPHXSNPTSA-N
|
|
Synonyms |
Montagnuphilone C; CHEMBL4062763; J3.616.323B
|
|
CAS | NA | |
PubChem CID | 132992079 | |
ChEMBL ID | CHEMBL4062763 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 436.4 | ALogp: | 0.4 |
HBD: | 5 | HBA: | 10 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 171.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.424 |
Caco-2 Permeability: | -5.969 | MDCK Permeability: | 0.00001240 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.996 |
Human Intestinal Absorption (HIA): | 0.931 | 20% Bioavailability (F20%): | 1 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.051 | Plasma Protein Binding (PPB): | 87.68% |
Volume Distribution (VD): | 0.41 | Fu: | 14.89% |
CYP1A2-inhibitor: | 0.053 | CYP1A2-substrate: | 0.1 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.049 |
CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.804 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.115 |
CYP3A4-inhibitor: | 0.164 | CYP3A4-substrate: | 0.077 |
Clearance (CL): | 6.517 | Half-life (T1/2): | 0.876 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.066 |
Drug-inuced Liver Injury (DILI): | 0.959 | AMES Toxicity: | 0.049 |
Rat Oral Acute Toxicity: | 0.351 | Maximum Recommended Daily Dose: | 0.033 |
Skin Sensitization: | 0.037 | Carcinogencity: | 0.756 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.028 |
Respiratory Toxicity: | 0.505 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003838 | 1.000 | D08NQZ | 0.256 | ||||
ENC003839 | 1.000 | D0R6RC | 0.252 | ||||
ENC003451 | 0.822 | D02GAC | 0.250 | ||||
ENC003450 | 0.822 | D05AFR | 0.248 | ||||
ENC005503 | 0.590 | D04VEJ | 0.245 | ||||
ENC003837 | 0.577 | D0J2NK | 0.243 | ||||
ENC002211 | 0.543 | D07MGA | 0.241 | ||||
ENC002132 | 0.532 | D0WY9N | 0.230 | ||||
ENC002726 | 0.529 | D03CEF | 0.227 | ||||
ENC003448 | 0.500 | D08LTU | 0.223 |