|
Name |
Comazaphilone D
|
Molecular Formula | C21H22O7 | |
IUPAC Name* |
[(6R,7R)-7-hydroxy-7-methyl-8-oxo-3-[(E)-prop-1-enyl]-5,6-dihydro-1H-isochromen-6-yl] 2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
C/C=C/C1=CC2=C(CO1)C(=O)[C@]([C@@H](C2)OC(=O)C3=C(C=C(C=C3C)O)O)(C)O
|
|
InChI |
InChI=1S/C21H22O7/c1-4-5-14-7-12-8-17(21(3,26)19(24)15(12)10-27-14)28-20(25)18-11(2)6-13(22)9-16(18)23/h4-7,9,17,22-23,26H,8,10H2,1-3H3/b5-4+/t17-,21-/m1/s1
|
|
InChIKey |
GIROBNCADSJPIJ-OQBWYENPSA-N
|
|
Synonyms |
Comazaphilone D; CHEBI:70013; MLS005941364; CHEMBL1689198; SMR004614078; Q27138354; (6R,7R)-7-Hydroxy-7-methyl-8-oxo-3-[prop-1-en-1-yl]-5,6,7,8-tetrahydro-1H-isochromen-6-yl 2,4-dihydroxy-6-methylbenzoate; [(6R,7R)-7-hydroxy-7-methyl-8-oxo-3-[(E)-prop-1-enyl]-5,6-dihydro-1H-isochromen-6-yl] 2,4-dihydroxy-6-methyl-benzoate; rel-(6R,7R)-7-hydroxy-7-methyl-8-oxo-3-[(1E)-prop-1-en-1-yl]-5,6,7,8-tetrahydro-1H-isochromen-6-yl 2,4-dihydroxy-6-methylbenzoate
|
|
CAS | NA | |
PubChem CID | 51041753 | |
ChEMBL ID | CHEMBL1689198 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 386.4 | ALogp: | 2.6 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 28 | QED Weighted: | 0.684 |
Caco-2 Permeability: | -4.925 | MDCK Permeability: | 0.00001800 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.044 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.782 |
30% Bioavailability (F30%): | 0.24 |
Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 94.97% |
Volume Distribution (VD): | 0.846 | Fu: | 3.18% |
CYP1A2-inhibitor: | 0.968 | CYP1A2-substrate: | 0.509 |
CYP2C19-inhibitor: | 0.596 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.739 | CYP2C9-substrate: | 0.876 |
CYP2D6-inhibitor: | 0.953 | CYP2D6-substrate: | 0.324 |
CYP3A4-inhibitor: | 0.839 | CYP3A4-substrate: | 0.209 |
Clearance (CL): | 5.225 | Half-life (T1/2): | 0.843 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.402 |
Drug-inuced Liver Injury (DILI): | 0.942 | AMES Toxicity: | 0.278 |
Rat Oral Acute Toxicity: | 0.397 | Maximum Recommended Daily Dose: | 0.964 |
Skin Sensitization: | 0.948 | Carcinogencity: | 0.866 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.878 |
Respiratory Toxicity: | 0.25 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002211 | 0.845 | D07MGA | 0.280 | ||||
ENC003837 | 0.826 | D08NQZ | 0.250 | ||||
ENC002132 | 0.791 | D0R6RC | 0.237 | ||||
ENC005503 | 0.652 | D0J2NK | 0.237 | ||||
ENC002131 | 0.649 | D08LTU | 0.235 | ||||
ENC003304 | 0.635 | D04AIT | 0.229 | ||||
ENC002606 | 0.583 | D02PMO | 0.227 | ||||
ENC003451 | 0.539 | D0H0SJ | 0.227 | ||||
ENC003450 | 0.539 | D02GAC | 0.226 | ||||
ENC003615 | 0.536 | D05AFR | 0.226 |