![]() |
Name |
bialternacin C
|
Molecular Formula | C30H26O12 | |
IUPAC Name* |
2-[2-[2-(2-carboxy-3-hydroxy-5-methoxyphenyl)-5,6-dihydroxy-3-methylphenyl]-3,4-dihydroxy-6-methylphenyl]-6-hydroxy-4-methoxybenzoicacid
|
|
SMILES |
COc1cc(O)c(C(=O)O)c(-c2c(C)cc(O)c(O)c2-c2c(O)c(O)cc(C)c2-c2cc(OC)cc(O)c2C(=O)O)c1
|
|
InChI |
InChI=1S/C30H26O12/c1-11-5-19(33)27(35)25(21(11)15-7-13(41-3)9-17(31)23(15)29(37)38)26-22(12(2)6-20(34)28(26)36)16-8-14(42-4)10-18(32)24(16)30(39)40/h5-10,31-36H,1-4H3,(H,37,38)(H,39,40)
|
|
InChIKey |
GVOFOMZTXCKMQG-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 578.53 | ALogp: | 5.0 |
HBD: | 8 | HBA: | 10 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 214.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 42 | QED Weighted: | 0.131 |
Caco-2 Permeability: | -6.469 | MDCK Permeability: | 0.00000404 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.023 |
Human Intestinal Absorption (HIA): | 0.954 | 20% Bioavailability (F20%): | 0.207 |
30% Bioavailability (F30%): | 0.999 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 98.02% |
Volume Distribution (VD): | 0.366 | Fu: | 2.19% |
CYP1A2-inhibitor: | 0.09 | CYP1A2-substrate: | 0.659 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.031 |
CYP2C9-inhibitor: | 0.346 | CYP2C9-substrate: | 0.036 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.096 |
CYP3A4-inhibitor: | 0.012 | CYP3A4-substrate: | 0.014 |
Clearance (CL): | 1.985 | Half-life (T1/2): | 0.84 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.416 |
Drug-inuced Liver Injury (DILI): | 0.998 | AMES Toxicity: | 0.042 |
Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.22 |
Skin Sensitization: | 0.023 | Carcinogencity: | 0.005 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.056 |
Respiratory Toxicity: | 0.35 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005426 | ![]() |
0.756 | D0B0AX | ![]() |
0.239 | ||
ENC005112 | ![]() |
0.702 | D0K8KX | ![]() |
0.237 | ||
ENC005427 | ![]() |
0.630 | D09LBS | ![]() |
0.237 | ||
ENC005424 | ![]() |
0.524 | D0Z2LG | ![]() |
0.237 | ||
ENC002867 | ![]() |
0.480 | D06GCK | ![]() |
0.231 | ||
ENC005646 | ![]() |
0.456 | D00KRE | ![]() |
0.229 | ||
ENC005423 | ![]() |
0.452 | D0WY9N | ![]() |
0.227 | ||
ENC001896 | ![]() |
0.424 | D04AIT | ![]() |
0.223 | ||
ENC005645 | ![]() |
0.421 | D00PEH | ![]() |
0.222 | ||
ENC004390 | ![]() |
0.413 | D08PCE | ![]() |
0.219 |