![]() |
Name |
(+)-Dialtenuisol
|
Molecular Formula | C28H18O11 | |
IUPAC Name* |
3,7,9-trihydroxy-1-methyl-8-(2,3,7-trihydroxy-9-methoxy-6-oxobenzo[c]chromen-4-yl)benzo[c]chromen-6-one
|
|
SMILES |
CC1=CC(=CC2=C1C3=CC(=C(C(=C3C(=O)O2)O)C4=C5C(=CC(=C4O)O)C6=C(C(=CC(=C6)OC)O)C(=O)O5)O)O
|
|
InChI |
InChI=1S/C28H18O11/c1-9-3-10(29)4-18-19(9)14-8-16(31)22(25(34)21(14)28(36)38-18)23-24(33)17(32)7-13-12-5-11(37-2)6-15(30)20(12)27(35)39-26(13)23/h3-8,29-34H,1-2H3
|
|
InChIKey |
VOJIAUIFCKMNMC-UHFFFAOYSA-N
|
|
Synonyms |
(+)-dialtenuisol; (-)-dialtenuisol
|
|
CAS | NA | |
PubChem CID | 156582461 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 530.4 | ALogp: | 5.1 |
HBD: | 6 | HBA: | 11 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 183.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 39 | QED Weighted: | 0.101 |
Caco-2 Permeability: | -5.842 | MDCK Permeability: | 0.00000654 |
Pgp-inhibitor: | 0.021 | Pgp-substrate: | 0.276 |
Human Intestinal Absorption (HIA): | 0.929 | 20% Bioavailability (F20%): | 0.067 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 88.71% |
Volume Distribution (VD): | 0.535 | Fu: | 26.06% |
CYP1A2-inhibitor: | 0.749 | CYP1A2-substrate: | 0.408 |
CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.045 |
CYP2C9-inhibitor: | 0.644 | CYP2C9-substrate: | 0.862 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.223 |
CYP3A4-inhibitor: | 0.072 | CYP3A4-substrate: | 0.017 |
Clearance (CL): | 3.441 | Half-life (T1/2): | 0.452 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.766 |
Drug-inuced Liver Injury (DILI): | 0.995 | AMES Toxicity: | 0.113 |
Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.966 |
Skin Sensitization: | 0.894 | Carcinogencity: | 0.013 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.899 |
Respiratory Toxicity: | 0.02 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002867 | ![]() |
0.656 | D0K8KX | ![]() |
0.347 | ||
ENC005112 | ![]() |
0.580 | D04AIT | ![]() |
0.331 | ||
ENC005191 | ![]() |
0.514 | D0AZ8C | ![]() |
0.265 | ||
ENC004846 | ![]() |
0.514 | D07MGA | ![]() |
0.263 | ||
ENC005808 | ![]() |
0.514 | D06GCK | ![]() |
0.257 | ||
ENC001653 | ![]() |
0.514 | D02TJS | ![]() |
0.254 | ||
ENC002516 | ![]() |
0.477 | D0FX2Q | ![]() |
0.231 | ||
ENC003507 | ![]() |
0.467 | D06NSS | ![]() |
0.217 | ||
ENC000922 | ![]() |
0.467 | D0TC7C | ![]() |
0.212 | ||
ENC005645 | ![]() |
0.464 | D0I9HF | ![]() |
0.210 |