![]() |
Name |
bialternacin B
|
Molecular Formula | C30H22O11 | |
IUPAC Name* |
2-(4,4'-dihydroxy-6-methoxy-2',8'-dimethyl-3,6'-dioxospiro[2-benzofuran-1,9'-dibenzofuran]-1'-yl)-6-hydroxy-4-methoxybenzoicacid
|
|
SMILES |
COc1cc(O)c(C(=O)O)c(-c2c(C)cc(O)c3oc4c(c23)C2(OC(=O)c3c(O)cc(OC)cc32)C(C)=CC4=O)c1
|
|
InChI |
InChI=1S/C30H22O11/c1-11-5-19(33)26-24(21(11)15-7-13(38-3)9-17(31)22(15)28(35)36)25-27(40-26)20(34)6-12(2)30(25)16-8-14(39-4)10-18(32)23(16)29(37)41-30/h5-10,31-33H,1-4H3,(H,35,36)/t30-/m0/s1
|
|
InChIKey |
NANKZARTAHBXBR-PMERELPUSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 558.5 | ALogp: | 4.8 |
HBD: | 4 | HBA: | 10 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 173.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 41 | QED Weighted: | 0.242 |
Caco-2 Permeability: | -5.89 | MDCK Permeability: | 0.00000781 |
Pgp-inhibitor: | 0.029 | Pgp-substrate: | 0.349 |
Human Intestinal Absorption (HIA): | 0.591 | 20% Bioavailability (F20%): | 0.075 |
30% Bioavailability (F30%): | 0.951 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 88.56% |
Volume Distribution (VD): | 0.516 | Fu: | 10.33% |
CYP1A2-inhibitor: | 0.166 | CYP1A2-substrate: | 0.885 |
CYP2C19-inhibitor: | 0.108 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.614 | CYP2C9-substrate: | 0.265 |
CYP2D6-inhibitor: | 0.045 | CYP2D6-substrate: | 0.139 |
CYP3A4-inhibitor: | 0.154 | CYP3A4-substrate: | 0.118 |
Clearance (CL): | 1.468 | Half-life (T1/2): | 0.621 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.737 |
Drug-inuced Liver Injury (DILI): | 0.995 | AMES Toxicity: | 0.722 |
Rat Oral Acute Toxicity: | 0.152 | Maximum Recommended Daily Dose: | 0.968 |
Skin Sensitization: | 0.276 | Carcinogencity: | 0.391 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.483 |
Respiratory Toxicity: | 0.328 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005427 | ![]() |
0.607 | D06GCK | ![]() |
0.257 | ||
ENC005426 | ![]() |
0.604 | D04AIT | ![]() |
0.250 | ||
ENC005112 | ![]() |
0.549 | D0FX2Q | ![]() |
0.250 | ||
ENC005425 | ![]() |
0.524 | D0K8KX | ![]() |
0.246 | ||
ENC005423 | ![]() |
0.510 | D0B0AX | ![]() |
0.239 | ||
ENC005428 | ![]() |
0.458 | D07MGA | ![]() |
0.236 | ||
ENC002867 | ![]() |
0.414 | D0AZ8C | ![]() |
0.235 | ||
ENC001896 | ![]() |
0.412 | D03RTK | ![]() |
0.235 | ||
ENC005173 | ![]() |
0.401 | D04ITO | ![]() |
0.231 | ||
ENC003592 | ![]() |
0.398 | D06NSS | ![]() |
0.225 |