![]() |
Name |
hydrohelvolic acid
|
Molecular Formula | C33H46O9 | |
IUPAC Name* |
2-(6,16-diacetyloxy-4,8,10,14-tetramethyl-3,7-dioxo-5,6,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene)-6-hydroxy-6-methylheptanoicacid
|
|
SMILES |
CC(=O)OC1CC2(C)C(CCC3C4(C)C=CC(=O)C(C)C4C(OC(C)=O)C(=O)C32C)C1=C(CCCC(C)(C)O)C(=O)O
|
|
InChI |
InChI=1S/C33H46O9/c1-17-22(36)13-15-31(6)24-12-11-21-25(20(29(38)39)10-9-14-30(4,5)40)23(41-18(2)34)16-32(21,7)33(24,8)28(37)27(26(17)31)42-19(3)35/h13,15,17,21,23-24,26-27,40H,9-12,14,16H2,1-8H3,(H,38,39)/b25-20-/t17-,21+,23+,24+,26-,27+,31-,32+,33-/m1/s1
|
|
InChIKey |
WLRJWQXWJBEULT-GAZAAFLYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 586.72 | ALogp: | 4.6 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 144.3 | Aromatic Rings: | 4 |
Heavy Atoms: | 42 | QED Weighted: | 0.309 |
Caco-2 Permeability: | -5.295 | MDCK Permeability: | 0.00002110 |
Pgp-inhibitor: | 0.963 | Pgp-substrate: | 0.059 |
Human Intestinal Absorption (HIA): | 0.476 | 20% Bioavailability (F20%): | 0.929 |
30% Bioavailability (F30%): | 0.537 |
Blood-Brain-Barrier Penetration (BBB): | 0.901 | Plasma Protein Binding (PPB): | 87.90% |
Volume Distribution (VD): | 0.47 | Fu: | 12.30% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.092 |
CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.707 |
CYP2C9-inhibitor: | 0.033 | CYP2C9-substrate: | 0.12 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.051 |
CYP3A4-inhibitor: | 0.344 | CYP3A4-substrate: | 0.316 |
Clearance (CL): | 2.105 | Half-life (T1/2): | 0.325 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.061 |
Drug-inuced Liver Injury (DILI): | 0.374 | AMES Toxicity: | 0.005 |
Rat Oral Acute Toxicity: | 0.955 | Maximum Recommended Daily Dose: | 0.672 |
Skin Sensitization: | 0.028 | Carcinogencity: | 0.378 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.036 |
Respiratory Toxicity: | 0.967 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005233 | ![]() |
1.000 | D0X7XG | ![]() |
0.391 | ||
ENC005234 | ![]() |
1.000 | D0G7KJ | ![]() |
0.291 | ||
ENC004398 | ![]() |
0.810 | D01ZOG | ![]() |
0.276 | ||
ENC004400 | ![]() |
0.810 | D0X2LV | ![]() |
0.271 | ||
ENC005067 | ![]() |
0.520 | D09IEE | ![]() |
0.270 | ||
ENC004790 | ![]() |
0.520 | D0F7NQ | ![]() |
0.269 | ||
ENC001083 | ![]() |
0.490 | D08BDT | ![]() |
0.267 | ||
ENC006108 | ![]() |
0.490 | D0H2MO | ![]() |
0.264 | ||
ENC004795 | ![]() |
0.480 | D03SXE | ![]() |
0.261 | ||
ENC003459 | ![]() |
0.480 | D09WYX | ![]() |
0.259 |